1. Borax is :
(a) Sodium metaborate
(b) Sodium orthoborate
(c) Sodium tetraborate
(d) Sodium tetraborate decahydrate
2. The two compounds sulphato penta-ammine cobalt(III) bromide and sulphato penta-ammine cobalt(III) chloride are examples for:
(a) Linkage isomerism
(b) Ionisation isomerism
(c) Co-ordination isomerism
(d) No isomerism.
3. An alkene in reaction with hot acidified KMnO4 gives succinic acid. The alkene is
(a) 1-butene
(b) 2-butene
(c) 2-methylbutene
(d) cyclobutene
Sunday, December 30, 2007
Monday, December 24, 2007
Application Questions Ch. 2 Gaseous, Liquid, and Solid States
1. to which of the following is Dalton's law of partial pressures not applicable?
a) H2 and He
b) NH3 and HCL
c) N2 and H2
d) N2 and O2
2. In silica (SiO2) each silicon atom is bonded to
a) two oxygen atoms
b) four oxygen atoms
c) one silicon and four oxygen atoms
d) octahedrally to six oxygen atoms
a) H2 and He
b) NH3 and HCL
c) N2 and H2
d) N2 and O2
2. In silica (SiO2) each silicon atom is bonded to
a) two oxygen atoms
b) four oxygen atoms
c) one silicon and four oxygen atoms
d) octahedrally to six oxygen atoms
Application Questions Ch. 3 Atomic Structure
1. The quantum numbers of last electron in an atom are 4,0,0,1/2. the atomic number of the element would be:
a) 21
b) 20
c) 19,20,29,30
d) 19,20
a) 21
b) 20
c) 19,20,29,30
d) 19,20
Application Questions Ch. 4 Periodic Table
1. Which of the following pairs of elements have almost similar atomic radii?
a) Zr, Hf
b) Mo, W
c) Co, Ni
d) all of these
a) Zr, Hf
b) Mo, W
c) Co, Ni
d) all of these
Application Questions Ch. 5 Bonding
Understand the following statements
1. CuSO4 has ionic, covalent and coordinate bonds
2. SO2 involves sp2 hybridization
3. HgCl2 and C2H2 are linear molecules
4. CH3+ has sp2 hybridization
5. SO2, NO2 and ClO2 are not linear while CO2 is linear.
6. NCO- has linear structure.
7. In ClO2- chlorine atom has sp3 hybridization
8. In OF2 oxygen atom will have sp3 hybridization.
9. N2O4 has covalent and coordinate bonds
10. Molecular oxygen has unpaired electrons.
11. NO3- has sp2 hybridization.
12. NO2+ has sp hybridization
MCQs
1. Which of the of following do not exhibit both ionic and covalent bond.
a) BaSo4
b) NH4Cl
c) Ca(NO3)2
d) HCl
2. Which of the following has maximum covalent character?
a) LiI
b) LiF
c) LiCl
d) LiBr
1. CuSO4 has ionic, covalent and coordinate bonds
2. SO2 involves sp2 hybridization
3. HgCl2 and C2H2 are linear molecules
4. CH3+ has sp2 hybridization
5. SO2, NO2 and ClO2 are not linear while CO2 is linear.
6. NCO- has linear structure.
7. In ClO2- chlorine atom has sp3 hybridization
8. In OF2 oxygen atom will have sp3 hybridization.
9. N2O4 has covalent and coordinate bonds
10. Molecular oxygen has unpaired electrons.
11. NO3- has sp2 hybridization.
12. NO2+ has sp hybridization
MCQs
1. Which of the of following do not exhibit both ionic and covalent bond.
a) BaSo4
b) NH4Cl
c) Ca(NO3)2
d) HCl
2. Which of the following has maximum covalent character?
a) LiI
b) LiF
c) LiCl
d) LiBr
Application Questions Ch. 6 Energetics
1. If 10.0 g of a radioactive isotope has a half life of 10 hours, the half life of 4.0 g of the same substance is
a) 2.5 hrs
b) 5 hrs
c) 10 hrs
d) 40 hrs
a) 2.5 hrs
b) 5 hrs
c) 10 hrs
d) 40 hrs
Application Questions Ch. 7 Chemical Equilibria
1. which oneof the following acids is stronger?
a) boric acid ka = 5.881*10^(-10)
b) acetic acid ka = 1.8*10^(-5)
c) benzoic acid ka = 6.3*10^(-5)
d) hydrocyanic acid ka = 7.2*10^(-10)
a) boric acid ka = 5.881*10^(-10)
b) acetic acid ka = 1.8*10^(-5)
c) benzoic acid ka = 6.3*10^(-5)
d) hydrocyanic acid ka = 7.2*10^(-10)
Application Questions Ch. 8 Electrochemistry
1. Beryllium is placed abvoe magnesium in the electrochemical series. When beryllium dust is added to MgCl2 solution it will
a) have no effect
b) precipitate Mg metal
c) liberate Cl2
d) precipitate MgCl2
a) have no effect
b) precipitate Mg metal
c) liberate Cl2
d) precipitate MgCl2
Application Questions Ch. 9 Solutions
1. a solution contains 8.84 g of H2SO4 in 10 ml and the density is 1.8 g/cc, the molality of the solution is
a) 12.55m
b) 6.20
c) 36.05
d) 9.85
a) 12.55m
b) 6.20
c) 36.05
d) 9.85
Application Questions Ch. 10 Chemical Kinetics
1. A large increase in the rate of a reactin with increase in temperature is due to
a) increase in the number of collisions
b) increase in the number of activated collisions
c) decrease in mean free path
d) decrease in activation energy
a) increase in the number of collisions
b) increase in the number of activated collisions
c) decrease in mean free path
d) decrease in activation energy
Application Questions - 13 Nonmetals
1. Which member of the group 13 does not exhibit the group valency in its compounds?
a) boron
b) aluminium
c) gallium
d) thallium
a) boron
b) aluminium
c) gallium
d) thallium
Application Questions - 15 Compounds of Nonmetals
1. which of the following leaves no risidue on heating?
a) Pb(NO3)2
b) NH4NO3
c) Cu (NO3)2
d) NaNO3
a) Pb(NO3)2
b) NH4NO3
c) Cu (NO3)2
d) NaNO3
Application Questions - 16 Transition elements
1. Which of the foloowing has the maximum number of unpairded d-electrons
a) Zn
b) Fe^2+
c) Ni^3+
d) Cu^+
a) Zn
b) Fe^2+
c) Ni^3+
d) Cu^+
Thursday, December 20, 2007
Application Questions - 22 Alkenes
1. An alkene on treating with hot acidified KMnO4 gives 4-oxopentanoic acid. The alkene is
(a) pentene
(b) 2-pentene
(c) 1-methylcyclobutene
(d) 1,2-dimethylcyclopropene
2. The addition of Br2 to trans-2-butene produces
(a) (+)-2,3-dibromobutane
(b) (-)-2,3-dibromobutane
(c) rac-2,3-dibromobutane
(d) meso-2,3-dibromobutane
3. The treatment of propene with Cl-2 at 500-600 °C produces
(a) 1,2-dichloropropane
(b) allyl chloride
(c) 2,3-dichloropropene
(d) 1,3-dichloropropene
4. The electrophilic addition of 1,3-butadiene produces
(a) 1,2-addition product only
(b) 1,4-addition product
(c) both 1,2- and 1,4- addition products which are not at equilibrium with each other
(d) both 1,2- and 1,4-addition products which are at equilibrium with each other
(a) pentene
(b) 2-pentene
(c) 1-methylcyclobutene
(d) 1,2-dimethylcyclopropene
2. The addition of Br2 to trans-2-butene produces
(a) (+)-2,3-dibromobutane
(b) (-)-2,3-dibromobutane
(c) rac-2,3-dibromobutane
(d) meso-2,3-dibromobutane
3. The treatment of propene with Cl-2 at 500-600 °C produces
(a) 1,2-dichloropropane
(b) allyl chloride
(c) 2,3-dichloropropene
(d) 1,3-dichloropropene
4. The electrophilic addition of 1,3-butadiene produces
(a) 1,2-addition product only
(b) 1,4-addition product
(c) both 1,2- and 1,4- addition products which are not at equilibrium with each other
(d) both 1,2- and 1,4-addition products which are at equilibrium with each other
Application Questions - 23 Alkynes
1. Which of the following is most acidic?
a) butane
b) 1-butene
c) 1-butyne
d) 2-butyne
2. Acetylene reacts with water in the presence of Hg^2+ and acidic medium to give
a) ethanal
b) ethanol
c) ethane
d) propanal
3. The compound which forms only acetaldehyde upon ozonolysis is:
a) Ethyne
b) Propene
c) 1-Butene
d) 2-Butene
4. The number of acidic hydrogen atoms in 1-butyne is
a) 1
b) 2
c) 3
d) 4
5. Which of the following can exhibit geometrical isomerism?
a) 2-butyne
b) 2-butene
c) 1-butene
d) 2-butanol
a) butane
b) 1-butene
c) 1-butyne
d) 2-butyne
2. Acetylene reacts with water in the presence of Hg^2+ and acidic medium to give
a) ethanal
b) ethanol
c) ethane
d) propanal
3. The compound which forms only acetaldehyde upon ozonolysis is:
a) Ethyne
b) Propene
c) 1-Butene
d) 2-Butene
4. The number of acidic hydrogen atoms in 1-butyne is
a) 1
b) 2
c) 3
d) 4
5. Which of the following can exhibit geometrical isomerism?
a) 2-butyne
b) 2-butene
c) 1-butene
d) 2-butanol
Monday, December 17, 2007
Past JEE Questions Introduction
A structure is created to post past JEE questions chapterwise for easy reference.
Candidates need to develop deep understanding of the concepts and procedures covered in the texts and then develop the ability to apply those concepts and procedures to the types of problems and questions posed in JEE examinations.
So candidates have to keep the textbook knowledge on right and JEE questions on left and keep turning the head in both directions repeatedly so that they are adequately prepared for facing the actual JEE examination.
Candidates need to develop deep understanding of the concepts and procedures covered in the texts and then develop the ability to apply those concepts and procedures to the types of problems and questions posed in JEE examinations.
So candidates have to keep the textbook knowledge on right and JEE questions on left and keep turning the head in both directions repeatedly so that they are adequately prepared for facing the actual JEE examination.
Past JEE Questions Ch.1
JEE Question 2007 paper I Linked Comprehension
Chemical reactions involve interaction of atoms and molecules. A large number of atoms/molecules (approximately 6.023 ×10^23 ) are present in a few grams of any chemical compound varying with their atomic/molecular masses. To handle such large numbers conveniently, the mole concept was introduced. This concept has implications in diverse areas such as analytical chemistry, biochemistry electrochemistry and radiochemistry. The following example illustrates a typical case, involving
chemical/electrochemical reaction, which requires a clear understanding of the mole concept.
A 4.0 molar aqueous solution NaCl is prepared and 500 mL of this solution is electrolysed. This leads to the evolution of chlorine gas at one of the electrodes (atomic mass : Na = 23, Hg = 200;1 Faraday = 96500 coulombs).
1. The total number of moles of chlorine gas evolved is
(A) 0.5
(B) 1.0
(C) 2.0
(D) 3.0
Answer: B
2. If the cathode is a Hg electrode, the maximum weight (g) of amalgam formed from this solution is
(A) 200
(B) 225
(C) 400
(D) 446
Answer: D
In presence of Hg cathode sodium ion will discharge in place of hydrogen gas due to over voltage in the form of amalgams.
Weight of amalgam = 2 × (23 + 200) = 446 g
3. The total charge (coulombs) required for compete electrolysis is
(A) 24125
(B) 48250
(C) 96500
(D) 193000
Answer: D
Total charge = 2 × 96500 = 193000 C
This question is better answered after studying the electro chemistry chapter.
--------------------------
JEE Question 2007 paper II
Consider a titration of potassium dichromate solution with acidified Mohr’s salt solution using diphenylamine as indicator. The number of moles of Mohr’s salt required per mole of dichromate is
(A) 3
(B) 4
(C) 5
(D) 6
Answer D
From Compounds of metals chapter
Mohr's salt is a double salt. FeSO-4.(NH-4)-2SO-4.6H-2O
It is obtained by mixing freshly prepared ferrous sulphate in solution with equal molar amounts of ammonium sulphate and then allow the solution to crystallize.
Chemical reactions involve interaction of atoms and molecules. A large number of atoms/molecules (approximately 6.023 ×10^23 ) are present in a few grams of any chemical compound varying with their atomic/molecular masses. To handle such large numbers conveniently, the mole concept was introduced. This concept has implications in diverse areas such as analytical chemistry, biochemistry electrochemistry and radiochemistry. The following example illustrates a typical case, involving
chemical/electrochemical reaction, which requires a clear understanding of the mole concept.
A 4.0 molar aqueous solution NaCl is prepared and 500 mL of this solution is electrolysed. This leads to the evolution of chlorine gas at one of the electrodes (atomic mass : Na = 23, Hg = 200;1 Faraday = 96500 coulombs).
1. The total number of moles of chlorine gas evolved is
(A) 0.5
(B) 1.0
(C) 2.0
(D) 3.0
Answer: B
2. If the cathode is a Hg electrode, the maximum weight (g) of amalgam formed from this solution is
(A) 200
(B) 225
(C) 400
(D) 446
Answer: D
In presence of Hg cathode sodium ion will discharge in place of hydrogen gas due to over voltage in the form of amalgams.
Weight of amalgam = 2 × (23 + 200) = 446 g
3. The total charge (coulombs) required for compete electrolysis is
(A) 24125
(B) 48250
(C) 96500
(D) 193000
Answer: D
Total charge = 2 × 96500 = 193000 C
This question is better answered after studying the electro chemistry chapter.
--------------------------
JEE Question 2007 paper II
Consider a titration of potassium dichromate solution with acidified Mohr’s salt solution using diphenylamine as indicator. The number of moles of Mohr’s salt required per mole of dichromate is
(A) 3
(B) 4
(C) 5
(D) 6
Answer D
From Compounds of metals chapter
Mohr's salt is a double salt. FeSO-4.(NH-4)-2SO-4.6H-2O
It is obtained by mixing freshly prepared ferrous sulphate in solution with equal molar amounts of ammonium sulphate and then allow the solution to crystallize.
Past JEE Questions Ch.2
JEE Question 2007 paper II
Matrix matching
Match the chemical system/units cells mentioned in column I with their characteristic features mentioned in column II. Indicate your answer by darkening the appropriate bubbles of the 4 × 4 matrix given in the ORS.
Column I------------------------- Column II
(A)simple cubic and ---------(p)have these cell
face-centred cubic------------parameters a = b = c and
------------------------------ α =β = γ
(B)cubic and rhombohedral-- (q) are two crystal systems
(C) cubic and tetragonal (r) Have only two
-----------------------------crystallographic angles of
------------------------------90°
(D) hexagonal and monoaclinic --(s) Belong to same
------------------------------------crystal system
Solution
A – p, s
B – p, q
C – q
D – r, q
----------------------------------
Matrix matching
Match the chemical system/units cells mentioned in column I with their characteristic features mentioned in column II. Indicate your answer by darkening the appropriate bubbles of the 4 × 4 matrix given in the ORS.
Column I------------------------- Column II
(A)simple cubic and ---------(p)have these cell
face-centred cubic------------parameters a = b = c and
------------------------------ α =β = γ
(B)cubic and rhombohedral-- (q) are two crystal systems
(C) cubic and tetragonal (r) Have only two
-----------------------------crystallographic angles of
------------------------------90°
(D) hexagonal and monoaclinic --(s) Belong to same
------------------------------------crystal system
Solution
A – p, s
B – p, q
C – q
D – r, q
----------------------------------
Past JEE Questions Ch.3 Atomic Structure
JEE Question 2007 paper II
Statement - 1
Band gap in germanium is small.
Because
Statement - 2
The energy spread of each germanium atomic energy level is infinitesimally small.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is NOT a correct explanation for Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Answer C
Statement - 1
Band gap in germanium is small.
Because
Statement - 2
The energy spread of each germanium atomic energy level is infinitesimally small.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is NOT a correct explanation for Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Answer C
Past JEE Questions Ch.5 Bonding and Molecular Structure
1991
The linear structure is not assumed by
a) SnCl2
b) CS2
c) NO2+
d) HCN
Answer a
1992
The molecule that will have no dipole meet is:
a) 2,2-dimethyl propene
b) Trans 2-pentene
c) cis-3-hexane
d)2,2,3,3,-tetramethylbutane
ans: d
1993
Which of the following has zero dipole moment?
a) CLF
b) PCl3
c) SiF4
d) CFCl3
ans: c
1995
Which is most ionic?
a) P2O5
b) MnO
c) CrO3
d) Mn2O7
b
1996
The number and type of bonds between two carbon atoms in calcium carbide are
a) one σ , one π
b) one σ, two π
c) two σ , one π
d) one σ, 1½ Ï€
Ans: b
1997
Which one of the following compounds has sp2 hybridization
a) CO2
b) SO2
c) N2O
d) CO
ans: b
1998
The geometry and type of hybrid orbital present about the central atom in BF3 is
a) linear, sp
b) trigonal planar, sp^2
c) tetrahedral, sp^3
d) pyramidal, sp^3
ans: b
1999
The geometry of H2S and its dipole moment are:
a) angular and non-zero
b) angular and zero
c) linear and non-zero
d) linear and zero
2000 screening
Molecular shapes of SF4, CF4, and XeF4 are
a) the same with 2,0,1 lone pairs of electrons respectively
b) the same with 1,1,1,lone pairs of electrons respectively
c) different with 0,1,and 2 lone pairs of electrons respectively
d) different with 1,0, and 2 lone pairs of electrons respectively
ans: d
2001 screening
The correct order of bybridization of the central atom in the following species: NH3, [PtCl4]2-, PCl5 and BCl3 is
a) dsp^2, dsp^3, sp^2, and sp^3
b) sp^3, dsp^2,dsp^3,sp^2
c) dsp^3,sp^2,sp^3,dsp^3
d) dsp^2,sp^3,sp^2,dsp^3
ans: b
Among the following, the molecule with the highest dipole moment is:
(A) CH-3Cl (B) CH-2Cl-2
(C) CHCl-3 (D) CCl-4
answer A
----------------------------
JEE Question 2007 paper I
The percentage of p-character in the orbitals forming P–P bonds in 4 P is
(A) 25
(B) 33
(C) 50
(D) 75
Solution: (D)
Phosphorous will show sp^3 hybridisation having 75% p-character.
--------
JEE Question 2007 paper I
Statement - 1
Boron always forms covalent bond
Because
Statement - 2
The small size of B3^+ favours formation of covalent bond.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Answer: A
-------------------------------
JEE Question paper II 2007
Among the following metal carbonyls, the C — O bond order is lowest in
(A) [Mn(CO)-6]^+
(B) [Fe(CO)-5]
(C) [Cr(CO)-6]
(D) [V(CO)-6]^-
answer: B
-----------------
JEE 2006
If the bond length of CO bond in carbon monoxide is 1.128 A,
then what is the value of CO bond length in Fe(CO)-5?
(A) 1.15 A
(B) 1.128 A
(C) 1.72 A
(D) 1.118 A
Answer: (A)
----------------------
The linear structure is not assumed by
a) SnCl2
b) CS2
c) NO2+
d) HCN
Answer a
1992
The molecule that will have no dipole meet is:
a) 2,2-dimethyl propene
b) Trans 2-pentene
c) cis-3-hexane
d)2,2,3,3,-tetramethylbutane
ans: d
1993
Which of the following has zero dipole moment?
a) CLF
b) PCl3
c) SiF4
d) CFCl3
ans: c
1995
Which is most ionic?
a) P2O5
b) MnO
c) CrO3
d) Mn2O7
b
1996
The number and type of bonds between two carbon atoms in calcium carbide are
a) one σ , one π
b) one σ, two π
c) two σ , one π
d) one σ, 1½ Ï€
Ans: b
1997
Which one of the following compounds has sp2 hybridization
a) CO2
b) SO2
c) N2O
d) CO
ans: b
1998
The geometry and type of hybrid orbital present about the central atom in BF3 is
a) linear, sp
b) trigonal planar, sp^2
c) tetrahedral, sp^3
d) pyramidal, sp^3
ans: b
1999
The geometry of H2S and its dipole moment are:
a) angular and non-zero
b) angular and zero
c) linear and non-zero
d) linear and zero
2000 screening
Molecular shapes of SF4, CF4, and XeF4 are
a) the same with 2,0,1 lone pairs of electrons respectively
b) the same with 1,1,1,lone pairs of electrons respectively
c) different with 0,1,and 2 lone pairs of electrons respectively
d) different with 1,0, and 2 lone pairs of electrons respectively
ans: d
2001 screening
The correct order of bybridization of the central atom in the following species: NH3, [PtCl4]2-, PCl5 and BCl3 is
a) dsp^2, dsp^3, sp^2, and sp^3
b) sp^3, dsp^2,dsp^3,sp^2
c) dsp^3,sp^2,sp^3,dsp^3
d) dsp^2,sp^3,sp^2,dsp^3
ans: b
Among the following, the molecule with the highest dipole moment is:
(A) CH-3Cl (B) CH-2Cl-2
(C) CHCl-3 (D) CCl-4
answer A
----------------------------
JEE Question 2007 paper I
The percentage of p-character in the orbitals forming P–P bonds in 4 P is
(A) 25
(B) 33
(C) 50
(D) 75
Solution: (D)
Phosphorous will show sp^3 hybridisation having 75% p-character.
--------
JEE Question 2007 paper I
Statement - 1
Boron always forms covalent bond
Because
Statement - 2
The small size of B3^+ favours formation of covalent bond.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Answer: A
-------------------------------
JEE Question paper II 2007
Among the following metal carbonyls, the C — O bond order is lowest in
(A) [Mn(CO)-6]^+
(B) [Fe(CO)-5]
(C) [Cr(CO)-6]
(D) [V(CO)-6]^-
answer: B
-----------------
JEE 2006
If the bond length of CO bond in carbon monoxide is 1.128 A,
then what is the value of CO bond length in Fe(CO)-5?
(A) 1.15 A
(B) 1.128 A
(C) 1.72 A
(D) 1.118 A
Answer: (A)
----------------------
Past JEE Questions Ch.6
JEE Question 2007 paper II
For the process (water becoming steam) H-2O(l)(1 bar, 373 K) --> H-2O(g)(1 bar, 373 K), the correct set of thermodynamic parameters is
(A) ∆G=0,∆S= + ve
(B)∆G=0,∆S= -ve
(C)∆G=+ve,∆S=0
(D)∆G=-ve, ∆S= + ve
Solution: A
The answer is A because, because at 100 degree C, the steam and water mixture is at equilibrium. Hence ΔG = 0(G = H - TS), and ΔS is positive. Why? when liquid becomes gas, there is more disorder. More entropy.
--------------
For the process (water becoming steam) H-2O(l)(1 bar, 373 K) --> H-2O(g)(1 bar, 373 K), the correct set of thermodynamic parameters is
(A) ∆G=0,∆S= + ve
(B)∆G=0,∆S= -ve
(C)∆G=+ve,∆S=0
(D)∆G=-ve, ∆S= + ve
Solution: A
The answer is A because, because at 100 degree C, the steam and water mixture is at equilibrium. Hence ΔG = 0(G = H - TS), and ΔS is positive. Why? when liquid becomes gas, there is more disorder. More entropy.
--------------
Past JEE Questions Ch.7 CHEMICAL EQUILIBRIA
JEE Question 2007 Paper II
23. Consider a reaction aG+bH--> Products. When concentration of both the reactants G and H is doubled, the rate increases by eight times. However, when concentration of G is doubled keeping the concentration of H fixed, the rate is doubled. The overall order of the reaction is
(A) 0
(B) 1
(C) 2
(D) 3
Solution: D
This is a question of chapter chemical kinetics.
Reason: When G alone is doubled, rate is doubled. That is the exponent of [G] is one in rate law. When both are doubled, rate increases by 8 times, telling us that exponent of [H] is 2 in rate law. So overall order of reaction is sum of the two exponents that is 3.
--------------------
23. Consider a reaction aG+bH--> Products. When concentration of both the reactants G and H is doubled, the rate increases by eight times. However, when concentration of G is doubled keeping the concentration of H fixed, the rate is doubled. The overall order of the reaction is
(A) 0
(B) 1
(C) 2
(D) 3
Solution: D
This is a question of chapter chemical kinetics.
Reason: When G alone is doubled, rate is doubled. That is the exponent of [G] is one in rate law. When both are doubled, rate increases by 8 times, telling us that exponent of [H] is 2 in rate law. So overall order of reaction is sum of the two exponents that is 3.
--------------------
Past JEE Questions Ch.9 SOLUTIONS
JEE Question 2007 paper I
When 20 g of naphthoic acid (C-11H-8O-2) is dissolved in 50 g of benzene (K-f = 1.72 K kg mol^-1), a freezing point depression of 2 K is observed. The van’t Hoff factor (i) is
(A) 0.5
(B) 1
(C) 2
(D) 3
Answer: A
Van't Hoff factor = Normal Molar Mass/Observed Molar mass
Observed Molar Mass M-B = K-f*1000*W-B/(W-A*ΔT-f)
K-f = Molal depression constant
W-A = weight of solvent
W-B = weight of solute
ΔT-f = depression in freezing point.
In the problem Normal Molar mass = 172
Observe molar mass = 1.72*1000*20/50*2 = 17.2*20 = 172*2
Van't Hoff factor =172/172*2 = 0.5
Ref: Dr. Jauhar's book unit 3: solutions.
When 20 g of naphthoic acid (C-11H-8O-2) is dissolved in 50 g of benzene (K-f = 1.72 K kg mol^-1), a freezing point depression of 2 K is observed. The van’t Hoff factor (i) is
(A) 0.5
(B) 1
(C) 2
(D) 3
Answer: A
Van't Hoff factor = Normal Molar Mass/Observed Molar mass
Observed Molar Mass M-B = K-f*1000*W-B/(W-A*ΔT-f)
K-f = Molal depression constant
W-A = weight of solvent
W-B = weight of solute
ΔT-f = depression in freezing point.
In the problem Normal Molar mass = 172
Observe molar mass = 1.72*1000*20/50*2 = 17.2*20 = 172*2
Van't Hoff factor =172/172*2 = 0.5
Ref: Dr. Jauhar's book unit 3: solutions.
Past JEE Questions Ch.11 SURFACE CHEMISTRY
JEE Question 2007 Paper I
Statement - 1
Micelles are formed by surfactant molecules above the critical micellar concentration (CMC)
Because
Statement - 2
The conductivity of a solution having surfactant molecules decreases sharply at the CMC.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for
statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for
Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Correct choice: B
-----
Statement - 1
Micelles are formed by surfactant molecules above the critical micellar concentration (CMC)
Because
Statement - 2
The conductivity of a solution having surfactant molecules decreases sharply at the CMC.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for
statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for
Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Correct choice: B
-----
Past JEE Questions Ch.12 NUCLEAR CHEMISTRY
1996
(27,13) Al is a stable isotope. (29,13) Al is expected to disintegrate by
a) α emission
b) β emission
c) positron emission
d) proton emission
1998
Loss of β particle is equivalent to
a) increase of one proton only
b) decrease of one neutron only
c) both of (a) and (b)
d) none of these
1998
Decrease in atomic number is observed during
a) α emission
b) β emission
c) positron emission
d) electron emission
1991
The nucleus resulting from (238, 92) U after successive emission of two α particles and four β particles is
a) (230,90) Th
b) 230,94 Pu
c) 230,88 Ra
d) 230,92 U
1991
The number of neutrons accompanying the formation of 139,54 Xe and 94,38 Sr from the absorption of slow neutron by 235,92 U followed by nuclear fission is
a) 0
b) 2
c) 1
d) 3
(27,13) Al is a stable isotope. (29,13) Al is expected to disintegrate by
a) α emission
b) β emission
c) positron emission
d) proton emission
1998
Loss of β particle is equivalent to
a) increase of one proton only
b) decrease of one neutron only
c) both of (a) and (b)
d) none of these
1998
Decrease in atomic number is observed during
a) α emission
b) β emission
c) positron emission
d) electron emission
1991
The nucleus resulting from (238, 92) U after successive emission of two α particles and four β particles is
a) (230,90) Th
b) 230,94 Pu
c) 230,88 Ra
d) 230,92 U
1991
The number of neutrons accompanying the formation of 139,54 Xe and 94,38 Sr from the absorption of slow neutron by 235,92 U followed by nuclear fission is
a) 0
b) 2
c) 1
d) 3
Past JEE Questions Ch.13 Non-Metal Elements
JEE question
Statement - 1
Boron always forms covalent bond
Because
Statement - 2
The small size of B^3+favours formation of covalent bond.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
answer A
This point is explicitly given in Jauhar's book
----------------------
JEE Question 2007 Paper I Linked Comprehension
The noble gases have closed-shell electronic configuration and are monoatomic gases under normal conditions. The low boiling points of the lighter noble gases are due to weak dispersion forces between the atoms and the absence of other interatomic interactions. The direct reaction of xenon with fluorine leads to a series of compounds with oxidation numbers +2, +4 and + 6. 4 XeF reacts violently with water to give XeO-3 . The compounds of xenon exhibit rich stereochemistry and their geometries can be deduced considering the total number of electron pairs in
the valence shell.
1. Argon is used in arc welding because of its
(A) low reactivity with metal
(B) ability to lower the melting point of metal
(C) flammability
(D) high calorific value
Solution: A
Argon provides inert atmosphere in welding due to low reactivity with metal.
2. The structure of XeO-3 is
(A) linear
(B) planar
(C) pyramidal
(D) T-shaped
Coorect choice: C
3. XeF-4 and XeF-6 are expected to be
(A) oxidizing
(B) reducing
(C) unreactive
(D) strong basic
Answer: A
----------------------------
Statement - 1
Boron always forms covalent bond
Because
Statement - 2
The small size of B^3+favours formation of covalent bond.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
answer A
This point is explicitly given in Jauhar's book
----------------------
JEE Question 2007 Paper I Linked Comprehension
The noble gases have closed-shell electronic configuration and are monoatomic gases under normal conditions. The low boiling points of the lighter noble gases are due to weak dispersion forces between the atoms and the absence of other interatomic interactions. The direct reaction of xenon with fluorine leads to a series of compounds with oxidation numbers +2, +4 and + 6. 4 XeF reacts violently with water to give XeO-3 . The compounds of xenon exhibit rich stereochemistry and their geometries can be deduced considering the total number of electron pairs in
the valence shell.
1. Argon is used in arc welding because of its
(A) low reactivity with metal
(B) ability to lower the melting point of metal
(C) flammability
(D) high calorific value
Solution: A
Argon provides inert atmosphere in welding due to low reactivity with metal.
2. The structure of XeO-3 is
(A) linear
(B) planar
(C) pyramidal
(D) T-shaped
Coorect choice: C
3. XeF-4 and XeF-6 are expected to be
(A) oxidizing
(B) reducing
(C) unreactive
(D) strong basic
Answer: A
----------------------------
Past JEE Questions Ch.14 COMPOUNDS OF METALS
JEE Question 2007 paper II
Statement - 1
Alkali metals dissolve in liquid ammonia to give blue solutions.
Because
Statement - 2
Alkali metals in liquid ammonia give solvated species of the type [M(NH-3)-n]^+ (M= alkali metals.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for
statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for
Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Solution: B
Blue colour appears due to solvated electrons in liquid ammonia.
Statement - 1
Alkali metals dissolve in liquid ammonia to give blue solutions.
Because
Statement - 2
Alkali metals in liquid ammonia give solvated species of the type [M(NH-3)-n]^+ (M= alkali metals.
(A) Statement – 1 is True, Statement – 2 is True; Statement – 2 is a correct explanation for
statement – 1
(B) Statement – 1 is True, Statement – 2 is True; Statement – 2 is Not a correct explanation for
Statement – 1.
(C) Statement – 1 is True, Statement – 2 is False
(D) Statement – 1 is False, Statement – 2 is True
Solution: B
Blue colour appears due to solvated electrons in liquid ammonia.
Past JEE Questions Ch.17 Ores/Minerals and Extractive Metallury
-----------------------
JEE Question 2007 Paper I
Extraction of zinc from zinc blende is achieved by
(A) electrolytic reduction
(B) roasting followed by reduction with carbon
(C) roasting followed by reduction with another metal
(D) roasting followed by self-reduction
Answer: B
Roasting followed by reduction with carbon.
---------------------------
JEE Question 2007 Paper I
Extraction of zinc from zinc blende is achieved by
(A) electrolytic reduction
(B) roasting followed by reduction with carbon
(C) roasting followed by reduction with another metal
(D) roasting followed by self-reduction
Answer: B
Roasting followed by reduction with carbon.
---------------------------
Past JEE Questions Ch.18 Exercises in Inorganic Chemistry
JEE Question 2007 paper II
A solution of a metal ion when treated with KI gives a red precipitate which dissolves in excess KI to give a colourless solution. Moreover, the solution of metal ion on treatment with a solution of cobalt(II) thiocyanate give rise to a deep blue crystalline precipitate. The metal ion is
(A) Pb2^+
(B) Hg2^+
(C) Cu2^+
(D) Co2^+
Answer: B
A solution of a metal ion when treated with KI gives a red precipitate which dissolves in excess KI to give a colourless solution. Moreover, the solution of metal ion on treatment with a solution of cobalt(II) thiocyanate give rise to a deep blue crystalline precipitate. The metal ion is
(A) Pb2^+
(B) Hg2^+
(C) Cu2^+
(D) Co2^+
Answer: B
Past JEE Questions Ch.19 Hybridization, Isomerism, and Nomenclature
JEE Question 2007 Paper I
The number of structural isomers for C-6H-14 is
(A) 3
(B) 4
(C) 5
(D) 6
Answer: C
--------------------------
JEE question 2007
STATEMENT-1: Molecules that are not superimposable on their mirror images are chiral.
Because
STATEMENT-2: All chiral molecules have chiral centres.
(A) Statement-1 is True, Statement-2 is True; Statement-2 is a correct explanation for Statement-1
(B) Statement-1 is True, Statement-2 is True; Statement-2 is not a correct explanation for
Statement-1
(C) Statement-1 is True, Statement-2 is False
(D) Statement-1 is False, Statement-2 is True
Solution C
----------------------------
JEE Question 2007 Paper II
The number of stereoisomers obtained by bromination of trans-2 butene is
(A) 1
(B) 2
(C) 3
(D) 4
Answer: A
Meso compound is the output.
---------------------------
The number of structural isomers for C-6H-14 is
(A) 3
(B) 4
(C) 5
(D) 6
Answer: C
--------------------------
JEE question 2007
STATEMENT-1: Molecules that are not superimposable on their mirror images are chiral.
Because
STATEMENT-2: All chiral molecules have chiral centres.
(A) Statement-1 is True, Statement-2 is True; Statement-2 is a correct explanation for Statement-1
(B) Statement-1 is True, Statement-2 is True; Statement-2 is not a correct explanation for
Statement-1
(C) Statement-1 is True, Statement-2 is False
(D) Statement-1 is False, Statement-2 is True
Solution C
----------------------------
JEE Question 2007 Paper II
The number of stereoisomers obtained by bromination of trans-2 butene is
(A) 1
(B) 2
(C) 3
(D) 4
Answer: A
Meso compound is the output.
---------------------------
Past JEE Questions Ch.22 Alkenes
1984
Baeyer's reagent is
a) alkaline potassium permanganate solution
b) acidified potassium permanganate solution
c) neutral potassium permanganate solution
d) acqueous bromine solution
1985.
anti-markonikov addition of HBr is not observed in
a) propene
b) butene
c) 2-butene
d) 2-pentene
1986
Dipole moment is shown by
a) 1,4 dichlorobenzene
b) cis-1,2-dichloroethene
c) trans-1,2-dichloroethene
d) 1,2-dichloro-2-pentene
Answer b and d
1987
4. of the following compounds, whihc will have a zero dipole moment
a) 1,1 dichloroethylene
b) cis-1,2-dichlorethylene
c) trans-1,2-dichloroethylene
d) none of these compounds
answer c
1991
5.1-chlorobutane on reaction with alcoholic potash gives
a) 1-butene
b) 1-butanol
c) 2-butene
d) 2-butanol
answer a
1992
6. The molecules that will have dipole moment are
a) 2,2-dimethylpropane
b) trans-2-pentene
c) cis-3-hexene
d) 2,2,3,3,-tetrametylbutane
answer b and c.
1993
Which of the following has the smallest heat of hydrogenation per mole?
a) 1-butene
b) trans-2-butene
c) cis-2-butene
d) 1,3-butadiene
answer d
1998
Which of the following compounds will show geometric isomerism?
a) 2-Butene
b) Propene
c) 1-Phenylpropene
d) 2-Methyl-2-butene
2000
Which of the following compounds will exhibit geometric isomerism?
a) 1-phenyl-2-butene
b) 3-phenyl-1-butene
c) 2-phenyl-1-butene
d) 1,1-Diphenyl-1-propene
JEE Question 2007 paper II
Cyclohexene on ozonolysis followed by reaction with zinc dust and water gives compound E. Compound E on further treatment with aqueous KOH yields compound F. Compound F is
Options given as pictures
Baeyer's reagent is
a) alkaline potassium permanganate solution
b) acidified potassium permanganate solution
c) neutral potassium permanganate solution
d) acqueous bromine solution
1985.
anti-markonikov addition of HBr is not observed in
a) propene
b) butene
c) 2-butene
d) 2-pentene
1986
Dipole moment is shown by
a) 1,4 dichlorobenzene
b) cis-1,2-dichloroethene
c) trans-1,2-dichloroethene
d) 1,2-dichloro-2-pentene
Answer b and d
1987
4. of the following compounds, whihc will have a zero dipole moment
a) 1,1 dichloroethylene
b) cis-1,2-dichlorethylene
c) trans-1,2-dichloroethylene
d) none of these compounds
answer c
1991
5.1-chlorobutane on reaction with alcoholic potash gives
a) 1-butene
b) 1-butanol
c) 2-butene
d) 2-butanol
answer a
1992
6. The molecules that will have dipole moment are
a) 2,2-dimethylpropane
b) trans-2-pentene
c) cis-3-hexene
d) 2,2,3,3,-tetrametylbutane
answer b and c.
1993
Which of the following has the smallest heat of hydrogenation per mole?
a) 1-butene
b) trans-2-butene
c) cis-2-butene
d) 1,3-butadiene
answer d
1998
Which of the following compounds will show geometric isomerism?
a) 2-Butene
b) Propene
c) 1-Phenylpropene
d) 2-Methyl-2-butene
2000
Which of the following compounds will exhibit geometric isomerism?
a) 1-phenyl-2-butene
b) 3-phenyl-1-butene
c) 2-phenyl-1-butene
d) 1,1-Diphenyl-1-propene
JEE Question 2007 paper II
Cyclohexene on ozonolysis followed by reaction with zinc dust and water gives compound E. Compound E on further treatment with aqueous KOH yields compound F. Compound F is
Options given as pictures
Past JEE Questions Ch.23
1998
Among the following the strongest acid is
a) HC≡CH
b) C6H6
c) C2H6
d) CH3OH
Among the following the strongest acid is
a) HC≡CH
b) C6H6
c) C2H6
d) CH3OH
JEE Questions Ch.25 Alcohols
---------------------
JEE 2006
(I) 1,2-dihydroxy benzene (II) 1,3-dihydroxy benzene
(III) 1,4-dihydroxy benzene (IV) Hydroxy benzene
The increasing order of boiling points of above mentioned alcohols is
(A) I < II < III < IV (B) I < II < IV < III
(C) IV < I < II < III (D) IV < II < I < III
Solution (C)
------------------------
JEE 2006
(I) 1,2-dihydroxy benzene (II) 1,3-dihydroxy benzene
(III) 1,4-dihydroxy benzene (IV) Hydroxy benzene
The increasing order of boiling points of above mentioned alcohols is
(A) I < II < III < IV (B) I < II < IV < III
(C) IV < I < II < III (D) IV < II < I < III
Solution (C)
------------------------
JEE Questions Ch.27 Aldehydes, Ketones
1. How will you convert
i) Acetone to 2-methyl-2-propanol
ii) Ethanal to 2-hydroxy-3-butenoic acid 1990
2. CH3COCH3-----base,catalyst---> ? -----acid,catalyst--> ? 1998
3.Benzene with one H substituted by CHO-----------K2Cr2O7, Conc.H2SO4--->?----PCl5--?----NH3----> ?-------P2O5---> ? 1986
4. Write the IUPAC name of CH2=CHCHO 1993
5. A ketone (A) which undergoes haloform reaction gives compound B on reduction. B on heating with conc. H2SO4 gives a compound (C) which forms monozonide(D). D on hydrolysis in the presence of zinc dust gives only acetaldehyde. Identify A,B,C,D. Write down the reactions involved. 1989
6. An alkene (A) on ozonolysis gives acetone and an aldehyde. The aldehyde is easily oxidized to an acid (B). When (B) is treated with bromine in the presence of phosphorus, it yields compound (C) which on hydrolysis gives an hydroxy acid (D). This acid can alos be obtained from acetone hy the reaction with hydrogen cyanide followed by hydrolysis. Identify the compounds A,B,C and D. 1991
7. An aldehyde, A (C11H8O) which does not undergo self aldol condensation gives benzaldehyde and two moles of B on ozonolysis. compound B on oxidation with silver ion gives oxalic acid. Idenity the compounds A and B. 1997
8. An organic compound A, C6H10O, on reaction with CH3MgBr followed by acid treatment gives compound B. The compound B on ozonolysis gives compound C, which in presence of a base gives 1-acetyl cyclopentene, D. The compound B on reaction with HBr gives compound E. Write structures of A,B,C,D and E. Show how D is formed from C. 2000
9. C6H5CHO + CH3COOC2H5-----NaOC2H5 in C2H5OH & heat------>? 1995
10. How many asymmetric carbon atoms are created during the complete reduction of benzil (PhCOCOPh) with LiAH4. Also write the number of possible stereoisomers of the product. 1997
11. Acetophenone on reaction with hydroxylamine hydrochloride can produce tow isomeric oximes. Write structures of the oximes. 1997
12. An alkene A(C16H16) on ozonolysis gives only one product B (C8H8O). Compound B on reaction with NaOH/I2 yields sodium benzoate. Compound B reacts with KOH/NH2NH2 yielding a hydrocarbon (C) C8h10. Write the structure of compound B and C. Based on this information two isomeric structures can be proposed for alkene A. Write their structures and identify the isomer which on catalytic hydrogenation (H2/Pd-C) gives a recemic mixture. 2001
13. The formation of cyanohydrin from ketone is an example of
a) Electrophyllic addition
b) Nucleophilic addition
c) Necleophilic substitution
d) Electrophilic substitution 1990
i) Acetone to 2-methyl-2-propanol
ii) Ethanal to 2-hydroxy-3-butenoic acid 1990
2. CH3COCH3-----base,catalyst---> ? -----acid,catalyst--> ? 1998
3.Benzene with one H substituted by CHO-----------K2Cr2O7, Conc.H2SO4--->?----PCl5--?----NH3----> ?-------P2O5---> ? 1986
4. Write the IUPAC name of CH2=CHCHO 1993
5. A ketone (A) which undergoes haloform reaction gives compound B on reduction. B on heating with conc. H2SO4 gives a compound (C) which forms monozonide(D). D on hydrolysis in the presence of zinc dust gives only acetaldehyde. Identify A,B,C,D. Write down the reactions involved. 1989
6. An alkene (A) on ozonolysis gives acetone and an aldehyde. The aldehyde is easily oxidized to an acid (B). When (B) is treated with bromine in the presence of phosphorus, it yields compound (C) which on hydrolysis gives an hydroxy acid (D). This acid can alos be obtained from acetone hy the reaction with hydrogen cyanide followed by hydrolysis. Identify the compounds A,B,C and D. 1991
7. An aldehyde, A (C11H8O) which does not undergo self aldol condensation gives benzaldehyde and two moles of B on ozonolysis. compound B on oxidation with silver ion gives oxalic acid. Idenity the compounds A and B. 1997
8. An organic compound A, C6H10O, on reaction with CH3MgBr followed by acid treatment gives compound B. The compound B on ozonolysis gives compound C, which in presence of a base gives 1-acetyl cyclopentene, D. The compound B on reaction with HBr gives compound E. Write structures of A,B,C,D and E. Show how D is formed from C. 2000
9. C6H5CHO + CH3COOC2H5-----NaOC2H5 in C2H5OH & heat------>? 1995
10. How many asymmetric carbon atoms are created during the complete reduction of benzil (PhCOCOPh) with LiAH4. Also write the number of possible stereoisomers of the product. 1997
11. Acetophenone on reaction with hydroxylamine hydrochloride can produce tow isomeric oximes. Write structures of the oximes. 1997
12. An alkene A(C16H16) on ozonolysis gives only one product B (C8H8O). Compound B on reaction with NaOH/I2 yields sodium benzoate. Compound B reacts with KOH/NH2NH2 yielding a hydrocarbon (C) C8h10. Write the structure of compound B and C. Based on this information two isomeric structures can be proposed for alkene A. Write their structures and identify the isomer which on catalytic hydrogenation (H2/Pd-C) gives a recemic mixture. 2001
13. The formation of cyanohydrin from ketone is an example of
a) Electrophyllic addition
b) Nucleophilic addition
c) Necleophilic substitution
d) Electrophilic substitution 1990
JEE Questions Ch.28 Carboxylic acids
1. Among the following the strongest acid is
a) HC≡HC
b0 C6H6
c) C2H6
d) CH3OH
1999
2 When propionic acid is treated with acqueous sodium bicarbonate CO2 is liberated. The C of CO2 comes from
a) methyl group
b) carboxylic group
c) Methylene group
d) bicarbonate
1999
3) Which of the following carboxylic acids undergoes decarboxylation easily
1995
4. Benzoyl chloride is prepared from benzoic acid by
a) Cl2, hv
b) SO2Cl2
c) SOCl2
d) Cl2, H2O
2000
5. Identify the order of boiling points
1. CH3CH2CH2CH2 OH
2. CH3CH2CH2CHO
3. CH3CH2CH2COOH
Screening 2002
screening 2002
a) HC≡HC
b0 C6H6
c) C2H6
d) CH3OH
1999
2 When propionic acid is treated with acqueous sodium bicarbonate CO2 is liberated. The C of CO2 comes from
a) methyl group
b) carboxylic group
c) Methylene group
d) bicarbonate
1999
3) Which of the following carboxylic acids undergoes decarboxylation easily
1995
4. Benzoyl chloride is prepared from benzoic acid by
a) Cl2, hv
b) SO2Cl2
c) SOCl2
d) Cl2, H2O
2000
5. Identify the order of boiling points
1. CH3CH2CH2CH2 OH
2. CH3CH2CH2CHO
3. CH3CH2CH2COOH
Screening 2002
screening 2002
Past JEE Questions Ch.30 Amines
1. How will you convert 4-nitroaniline to 1,2,3-tribromobenzene 1990
2. How will you synthesis benzamide from nitrobenzene? 1994
3. How do you prepare m-bromoiodo benzene from benzene? 1997
4. Write the structure of products of the following reaction
CH3CONHC6H5 ----Br2,Fe--->
5. How will you bring about conversion of analine to benzylamine?
6. Arrange the following in the decreasing order of basic character:
a) Methylamine, dimethylamine, aniline, N-methylaniline
b) CH3CH2CH2NH2, HO(CH2)3NH2, HO(CH2)2NH2
c) CH2=CHCH2NH2, CH3CH2CH2NH2, CH≡CCH2NH2
7. p-chloroaniline and anilinium hydrochlordie can be distinguished by
a) sanmeyer's reaction
b) NaHCO3
c)AgNO3
d) Carbylamine test 1998
8. Among the following the strongest base is
a) C6H5NH2
b) p-NO2-C6H4NH2
c) m-NO2-C6H4NH2
d) C6H5CH2NH2 2000
9. In reaction of p-chlorotoluene with KNH2 in liquid NH3, the major product is
a) 0-toluidine
b) m-toluidine
c) p-toluidine
d) p-chloroaniline 1997
2. How will you synthesis benzamide from nitrobenzene? 1994
3. How do you prepare m-bromoiodo benzene from benzene? 1997
4. Write the structure of products of the following reaction
CH3CONHC6H5 ----Br2,Fe--->
5. How will you bring about conversion of analine to benzylamine?
6. Arrange the following in the decreasing order of basic character:
a) Methylamine, dimethylamine, aniline, N-methylaniline
b) CH3CH2CH2NH2, HO(CH2)3NH2, HO(CH2)2NH2
c) CH2=CHCH2NH2, CH3CH2CH2NH2, CH≡CCH2NH2
7. p-chloroaniline and anilinium hydrochlordie can be distinguished by
a) sanmeyer's reaction
b) NaHCO3
c)AgNO3
d) Carbylamine test 1998
8. Among the following the strongest base is
a) C6H5NH2
b) p-NO2-C6H4NH2
c) m-NO2-C6H4NH2
d) C6H5CH2NH2 2000
9. In reaction of p-chlorotoluene with KNH2 in liquid NH3, the major product is
a) 0-toluidine
b) m-toluidine
c) p-toluidine
d) p-chloroaniline 1997
Thursday, December 6, 2007
Blog Status 7-12-2007
I am only posting basic questions that help in clarifying basics of the topic.After I complete posting basic questions in all the chapters and posting answers to them, I shall attempt more varieties. As this blog posting is part of my effort to provide limited help to a person with a formal coaching with professional faculty, the pressure on me is limited and I take up activity only when I find some time.
Sunday, December 2, 2007
2007 JEE questions pattern
Topic -------------No. of questions
States of Matter------------1
-Solid state ---------------1
Atomic Structure & ---------6
Chemical Bonding
Dilute Solutions------------1
Thermodynamics--------------2
Chemical kinetics-----------1
Redox reaction--------------2
Surface Chemistry----------1
Electrochemistry-----------5
Nuclear chemistry----------1
Coordination Compounds-----2
P Block Elements-----------4
S block elements----------1
Metallurgy-----------------1
Basic Principles in
Organic Chemistry----------2
Hydrocarbons---------------2
Biomolecules / Polymers----2
Qualitative analysis------1
Aldehyde and ketone-------1
Stereo chemistry----------2
Purification and ---------1
characterization of
organic compounds
Phenols------------------3
Organic reactions--------1
Total questions---------44
States of Matter------------1
-Solid state ---------------1
Atomic Structure & ---------6
Chemical Bonding
Dilute Solutions------------1
Thermodynamics--------------2
Chemical kinetics-----------1
Redox reaction--------------2
Surface Chemistry----------1
Electrochemistry-----------5
Nuclear chemistry----------1
Coordination Compounds-----2
P Block Elements-----------4
S block elements----------1
Metallurgy-----------------1
Basic Principles in
Organic Chemistry----------2
Hydrocarbons---------------2
Biomolecules / Polymers----2
Qualitative analysis------1
Aldehyde and ketone-------1
Stereo chemistry----------2
Purification and ---------1
characterization of
organic compounds
Phenols------------------3
Organic reactions--------1
Total questions---------44
Blog Status 2-12- 2007
Today, I posted questions in chemical kinetics chapter.
iit-jee-chemistry-ps.blogspot.com/2007/10/iit-jee-chemistry-questions-ch10.html
iit-jee-chemistry-ps.blogspot.com/2007/10/iit-jee-chemistry-questions-ch10.html
Monday, October 29, 2007
Current Status of the blog
I put in the streamlined structure to the blog today. The questions are posted in many of the chapters of organic chemistry. I shall work on other chapters from now on. In each chapter, different varieties of questions will be posted. Apart from this questions from a mix of chapters will be posted in pages earmarked for questions from all the chapters. These questions may serve the purpose of sample paper.
IIT JEE Chemistry Question Bank ch 1. THE CONCEPT OF ATOMS AND MOLECULES
General topics:
Concept of atoms and molecules;
Dalton’s atomic theory;
Mole concept; Chemical formulae; Balanced chemical equations; Calculations (based on mole concept) involving common oxidation-reduction, neutralisation, and displacement reactions;
Concentration in terms of mole fraction, molarity, molality and normality.
-------------------
Concept of atoms and molecules;
Dalton’s atomic theory;
Mole concept; Chemical formulae; Balanced chemical equations; Calculations (based on mole concept) involving common oxidation-reduction, neutralisation, and displacement reactions;
Concentration in terms of mole fraction, molarity, molality and normality.
-------------------
IIT JEE Chemistry Questions Ch.2. GASEOUS, LIQUID AND SOLID STATES
Gaseous and liquid states: Absolute scale of temperature, ideal gas equation; Deviation from ideality, van der Waals equation; Kinetic theory of gases, average, root mean square and most probable velocities and their relation with temperature; Law of partial pressures; Vapour pressure; Diffusion of gases.
Solid state: Classification of solids, crystalline state, seven crystal systems (cell parameters a, b, c, alpha, beta, gamma), close packed structure of solids (cubic), packing in fcc, bcc and hcp lattices; Nearest neighbours, ionic radii, simple ionic compounds, point defects.
-------------------------
Solid state: Classification of solids, crystalline state, seven crystal systems (cell parameters a, b, c, alpha, beta, gamma), close packed structure of solids (cubic), packing in fcc, bcc and hcp lattices; Nearest neighbours, ionic radii, simple ionic compounds, point defects.
-------------------------
IIT JEE Chemistry Questions Ch.3. ATOMIC STRUCTURE
Atomic structure :
Bohr model,
spectrum of hydrogen atom,
quantum numbers;
Wave-particle duality,
de Broglie hypothesis;
Uncertainty principle;
Qualitative quantum mechanical picture of hydrogen atom,
shapes of s, p and d orbitals;
Electronic configurations of elements (up to atomic number 36);
Aufbau principle;
Pauli’s exclusion principle and
Hund’s rule;
-----------------------
Direct theory questions
1. Explain the following terms
a. Energy level
b. Sublevel
c. orbital
d.aufbau order
e. Hund's rule
f. principal quantum number
g. secondary quantum number
h. magentic quantum number
i. spin quantum number
j. Pauli exclusion principle
2. What is Bohr theory of atomic struncture?
3. Wuat is the quantum mechanical theory or model of atomic structure?
Aplication questions
1. How does Hund's rule explain the fact that oxygen has two unpaired electrons?
2. Explain why the maximum number of electrons in the fifth energy level is 50 (2*2^2).
3. Tell what is wrong in the following set of quantum numbers
2,2,0, +1/2
Bohr model,
spectrum of hydrogen atom,
quantum numbers;
Wave-particle duality,
de Broglie hypothesis;
Uncertainty principle;
Qualitative quantum mechanical picture of hydrogen atom,
shapes of s, p and d orbitals;
Electronic configurations of elements (up to atomic number 36);
Aufbau principle;
Pauli’s exclusion principle and
Hund’s rule;
-----------------------
Direct theory questions
1. Explain the following terms
a. Energy level
b. Sublevel
c. orbital
d.aufbau order
e. Hund's rule
f. principal quantum number
g. secondary quantum number
h. magentic quantum number
i. spin quantum number
j. Pauli exclusion principle
2. What is Bohr theory of atomic struncture?
3. Wuat is the quantum mechanical theory or model of atomic structure?
Aplication questions
1. How does Hund's rule explain the fact that oxygen has two unpaired electrons?
2. Explain why the maximum number of electrons in the fifth energy level is 50 (2*2^2).
3. Tell what is wrong in the following set of quantum numbers
2,2,0, +1/2
IIT JEE Chemistry Questions Ch.5. BONDING AND MOLECULAR STRUCTURE
Orbital overlap and covalent bond;
Hybridisation involving s, p and d orbitals only;
Orbital energy diagrams for homonuclear diatomic species;
Hydrogen bond;
Polarity in molecules, dipole moment (qualitative aspects only);
VSEPR model and shapes of molecules (linear, angular, triangular, square planar, pyramidal, square pyramidal, trigonal bipyramidal, tetrahedral and octahedral).
------------------
Theory Questions
Orbital overlap and covalent bond;
1. State the octet rule?
2. What are the instances where octet rule was found inadequate?
3. What is covalent bond?
4. What is coordinate covalent bond?
5. Name some molecules of having same atoms that have double bond.
6. Name some molecules of having same atoms that have triple double bond.
7. Name some compounds where N atom does not complete it octet.
8. do covalent bonds have directional character.
9. what is a coordinate bond?
10. give some examples of molecules having coordinate bonds.
Hybridisation involving s, p and d orbitals only;
1. Explain the need for the concept of hybridization?
2. Exlain the concept of hybridization.
3.
Orbital energy diagrams for homonuclear diatomic species;
VSEPR model and shapes of molecules (linear, angular, triangular, square planar, pyramidal, square pyramidal, trigonal bipyramidal, tetrahedral and octahedral).
1. What is VSEPR formulated? What does it try to explain?
2. What are the postulates of VSEPR theory?
3. What is the strength of repulsive forces over various possible pairs of electrons?
4.Why there are distortions in certain molecules from standard geometrical shapes indicated by the number of electron pairs?
5. Give examples of molecules that have linear arrangement of atoms.
6. Give examples of molecules that have trigonal planar arrangement of atoms.
7. Give examples of molecules that have tetrahedral arrangement of atoms.
8.Give examples of molecules that have trigonal bipyramidal arrangement of atoms.
9. Give examples of molecules that have octahedral arrangement of atoms.
10. Give examples of molecules that have pentagonal bipyramidal arrangement of atoms.
11. Give the geometrical shapes for molecules havng 2 to 7 electronic pairs around the central atom in a molecule.
Polarity in molecules, dipole moment (qualitative aspects only);
Hydrogen bond;
Concepts
1. State the octet rule?
2. What are the instances where octet rule was found inadequate?
3. Give important features of valence bond theory.
4. give different overlaps between 's' and 'p' orbitals and also give one example of each.
5. Explain the need for the concept of hybridization?
6. Exlain the concept of hybridization.
7. Explain the formation of sigma bond.
8.Explain the formation of pi bond.
9. Define bond energy?
10. What is ionic bond?
11. What is covalent bond?
12. What is coordinate covalent bond?
Applications and Examples
1. Why is H-F bond polar?
2. Give the geometry of hyubridised orbital in the following compounds.
a. Methane
b. water
c. ethyne
d. Boron trifluoride
e. Ammonia
f. BeF-2
g. ethene
3. Why bond angle in ammonia molecule is less than the expected tetrahedral bond angle?
4. There is only one pi-bond in ethylene molecule but here are two pi-bonds in the acytylene moecule. Explain.
5. Why a sigma bond is stronger than pi-bond?
6. The bond energy of PCl-3 is larger than the bond energy ni PCl-5. Why?
7. Bond energy in HF is larger than HI. Why?
8. Why H-O-H bond angle in water molecule is reduced to 104° 35'?
Hybridisation involving s, p and d orbitals only;
Orbital energy diagrams for homonuclear diatomic species;
Hydrogen bond;
Polarity in molecules, dipole moment (qualitative aspects only);
VSEPR model and shapes of molecules (linear, angular, triangular, square planar, pyramidal, square pyramidal, trigonal bipyramidal, tetrahedral and octahedral).
------------------
Theory Questions
Orbital overlap and covalent bond;
1. State the octet rule?
2. What are the instances where octet rule was found inadequate?
3. What is covalent bond?
4. What is coordinate covalent bond?
5. Name some molecules of having same atoms that have double bond.
6. Name some molecules of having same atoms that have triple double bond.
7. Name some compounds where N atom does not complete it octet.
8. do covalent bonds have directional character.
9. what is a coordinate bond?
10. give some examples of molecules having coordinate bonds.
Hybridisation involving s, p and d orbitals only;
1. Explain the need for the concept of hybridization?
2. Exlain the concept of hybridization.
3.
Orbital energy diagrams for homonuclear diatomic species;
VSEPR model and shapes of molecules (linear, angular, triangular, square planar, pyramidal, square pyramidal, trigonal bipyramidal, tetrahedral and octahedral).
1. What is VSEPR formulated? What does it try to explain?
2. What are the postulates of VSEPR theory?
3. What is the strength of repulsive forces over various possible pairs of electrons?
4.Why there are distortions in certain molecules from standard geometrical shapes indicated by the number of electron pairs?
5. Give examples of molecules that have linear arrangement of atoms.
6. Give examples of molecules that have trigonal planar arrangement of atoms.
7. Give examples of molecules that have tetrahedral arrangement of atoms.
8.Give examples of molecules that have trigonal bipyramidal arrangement of atoms.
9. Give examples of molecules that have octahedral arrangement of atoms.
10. Give examples of molecules that have pentagonal bipyramidal arrangement of atoms.
11. Give the geometrical shapes for molecules havng 2 to 7 electronic pairs around the central atom in a molecule.
Polarity in molecules, dipole moment (qualitative aspects only);
Hydrogen bond;
Concepts
1. State the octet rule?
2. What are the instances where octet rule was found inadequate?
3. Give important features of valence bond theory.
4. give different overlaps between 's' and 'p' orbitals and also give one example of each.
5. Explain the need for the concept of hybridization?
6. Exlain the concept of hybridization.
7. Explain the formation of sigma bond.
8.Explain the formation of pi bond.
9. Define bond energy?
10. What is ionic bond?
11. What is covalent bond?
12. What is coordinate covalent bond?
Applications and Examples
1. Why is H-F bond polar?
2. Give the geometry of hyubridised orbital in the following compounds.
a. Methane
b. water
c. ethyne
d. Boron trifluoride
e. Ammonia
f. BeF-2
g. ethene
3. Why bond angle in ammonia molecule is less than the expected tetrahedral bond angle?
4. There is only one pi-bond in ethylene molecule but here are two pi-bonds in the acytylene moecule. Explain.
5. Why a sigma bond is stronger than pi-bond?
6. The bond energy of PCl-3 is larger than the bond energy ni PCl-5. Why?
7. Bond energy in HF is larger than HI. Why?
8. Why H-O-H bond angle in water molecule is reduced to 104° 35'?
IIT JEE Chemistry Questions Ch. 6 ENERGETICS
Energetics:
First law of thermodynamics;
Internal energy, work and heat, pressure-volume work;
Enthalpy, Hess’s law;
Heat of reaction, fusion and vapourization;
Second law of thermodynamics;
Entropy;
Free energy;
Criterion of spontaneity.
------------
1. Define the following terms;
a. Thermodynamics.
b. Open system
c. Heat capacity
d. Heat of formation
e. Enthalpy
f. Heat of combustion
g. Heatof neutralization
h. Isothermal process
i. Isothermal process
j. Intramole energy
k. Intermole energy
l. Molar heat energy
m. Heat of reaction
n. Heat of combustion
o. Adiabatic process
p. Exothermic reaction
q. Endothermic reaction
2. State the first law of thermodynamics in its two forms.
3. Give two statements of law conservation of energy.
4. What is Kirchoff's equation?
5. How do you express a thermochemical equation?
First law of thermodynamics;
Internal energy, work and heat, pressure-volume work;
Enthalpy, Hess’s law;
Heat of reaction, fusion and vapourization;
Second law of thermodynamics;
Entropy;
Free energy;
Criterion of spontaneity.
------------
1. Define the following terms;
a. Thermodynamics.
b. Open system
c. Heat capacity
d. Heat of formation
e. Enthalpy
f. Heat of combustion
g. Heatof neutralization
h. Isothermal process
i. Isothermal process
j. Intramole energy
k. Intermole energy
l. Molar heat energy
m. Heat of reaction
n. Heat of combustion
o. Adiabatic process
p. Exothermic reaction
q. Endothermic reaction
2. State the first law of thermodynamics in its two forms.
3. Give two statements of law conservation of energy.
4. What is Kirchoff's equation?
5. How do you express a thermochemical equation?
IIT JEE Chemistry Questions Ch. 7. CHEMICAL EQUILIBRIA
Chemical equilibrium:
Law of mass action;
Equilibrium constant,
Le Chatelier's principle (effect of concentration, temperature and pressure); Significance of DG and DGo in chemical equilibrium;
Solubility product,
common ion effect,
pH and buffer solutions;
Acids and bases (Bronsted and Lewis concepts);
Hydrolysis of salts.
-----------------------
Law of mass action;
Equilibrium constant,
Le Chatelier's principle (effect of concentration, temperature and pressure); Significance of DG and DGo in chemical equilibrium;
Solubility product,
common ion effect,
pH and buffer solutions;
Acids and bases (Bronsted and Lewis concepts);
Hydrolysis of salts.
-----------------------
IIT JEE Chemistry Questions Ch.8 ELECTROCHEMISTRY
Electrochemistry:
Electrochemical cells and cell reactions;
Standard electrode potentials;
Nernst equation and its relation to DG;
Electrochemical series, emf of galvanic cells;
Faraday's laws of electrolysis;
Electrolytic conductance, specific, equivalent and molar conductivity, Kohlrausch's law;
Concentration cells.
-------------
1. What electrolysis?
2. State Faraday's first law of electrolysis
3. State Faraday's second law of electrolysis.
4. What is electrochemical cell?
5.How is galvanic cell represented?
6. what is a reference electrode?
7. what is a Standard Hydrogen Electrode?
8. what is the purpose of a salt bridge?
9. Distinguish between electrolytic and electrochemical cell.
10. What is standard oxidation potential?
11. What is an electrochemical series?
12. Give the Nernst equation.
Electrochemical cells and cell reactions;
Standard electrode potentials;
Nernst equation and its relation to DG;
Electrochemical series, emf of galvanic cells;
Faraday's laws of electrolysis;
Electrolytic conductance, specific, equivalent and molar conductivity, Kohlrausch's law;
Concentration cells.
-------------
1. What electrolysis?
2. State Faraday's first law of electrolysis
3. State Faraday's second law of electrolysis.
4. What is electrochemical cell?
5.How is galvanic cell represented?
6. what is a reference electrode?
7. what is a Standard Hydrogen Electrode?
8. what is the purpose of a salt bridge?
9. Distinguish between electrolytic and electrochemical cell.
10. What is standard oxidation potential?
11. What is an electrochemical series?
12. Give the Nernst equation.
IIT JEE Chemistry Questions Ch 9. SOLUTIONS
Solutions:
Raoult's law;
Molecular weight determination from lowering of vapour pressure, elevation of boiling point and depression of freezing point.
--------------
Raoult's law;
Molecular weight determination from lowering of vapour pressure, elevation of boiling point and depression of freezing point.
--------------
Sunday, October 28, 2007
IIT JEE Chemistry Questions Ch.10. CHEMICAL KINETICS
Chemical kinetics:
Rates of chemical reactions;
Order of reactions;
Rate constant;
First order reactions;
Temperature dependence of rate constant (Arrhenius equation).
---------------
Theory
1. Define or explain each of the following concepts
a) Chemical kinetics
b) reaction rate
c) rate law
d) reaction constant
e) reaction mechanism
f) rate determining step
g) Law of Mass Action
h) Order of reaction of a reactant
i) Overall order of reaction
j) Collision theory
k) activation energy
l) catalyst
k) negative catalyst
l) inhibitor
2. What changes rate constant of a reaction for a given set of reactants?
3. What changes rate of reaction for a given set of reactants?
4. How can you predict change in rate of reaction if you know the rate law?
5. What are units of rate of reaction?
6. What is the order of a reaction? How is it determined?
7. When are the units of rate constant and rate of reaction identical?
8. Describe the behaviour of rate constant with respect to temperature?
9. what are the units of activation energy?
10. How do you measure activation energy?
Rates of chemical reactions;
Order of reactions;
Rate constant;
First order reactions;
Temperature dependence of rate constant (Arrhenius equation).
---------------
Theory
1. Define or explain each of the following concepts
a) Chemical kinetics
b) reaction rate
c) rate law
d) reaction constant
e) reaction mechanism
f) rate determining step
g) Law of Mass Action
h) Order of reaction of a reactant
i) Overall order of reaction
j) Collision theory
k) activation energy
l) catalyst
k) negative catalyst
l) inhibitor
2. What changes rate constant of a reaction for a given set of reactants?
3. What changes rate of reaction for a given set of reactants?
4. How can you predict change in rate of reaction if you know the rate law?
5. What are units of rate of reaction?
6. What is the order of a reaction? How is it determined?
7. When are the units of rate constant and rate of reaction identical?
8. Describe the behaviour of rate constant with respect to temperature?
9. what are the units of activation energy?
10. How do you measure activation energy?
IIT JEE Chemistry Questions Ch. 11. SURFACE CHEMISTRY
Surface chemistry:
Elementary concepts of adsorption (excluding adsorption isotherms);
Colloids: types, methods of preparation and general properties;
Elementary ideas of emulsions, surfactants and micelles (only definitions and examples).
-----------------
1. What is adsorption?
2. distinguish between adsoprtion and absoprtion.
3. Distinguish between physical adsoprtion and chemical adsoprtion.
4. What is adsorbent?
5. what is adsorbate?
6. Explain the role of adsorption in catalysis.
7. Distinguish between emulsion and gel.
8. Distinguish between colloid solution and true solution.
9. Distinguish between lyophilic colloids and lyophobic colloids.
Elementary concepts of adsorption (excluding adsorption isotherms);
Colloids: types, methods of preparation and general properties;
Elementary ideas of emulsions, surfactants and micelles (only definitions and examples).
-----------------
1. What is adsorption?
2. distinguish between adsoprtion and absoprtion.
3. Distinguish between physical adsoprtion and chemical adsoprtion.
4. What is adsorbent?
5. what is adsorbate?
6. Explain the role of adsorption in catalysis.
7. Distinguish between emulsion and gel.
8. Distinguish between colloid solution and true solution.
9. Distinguish between lyophilic colloids and lyophobic colloids.
IIT JEE Chemistry Question Bank Ch.12. NUCLEAR CHEMISTRY
Nuclear chemistry:
Radioactivity:
isotopes and isobars;
Properties of alpha, beta and gamma rays;
Kinetics of radioactive decay (decay series excluded), carbon dating;
Stability of nuclei with respect to proton-neutron ratio;
Brief discussion on fission and fusion reactions.
-------------
1. Isotopes have same atomic number. State True or false.
2. What is atomic number(Z)?
3. what is Mass Number (A)?
4. What is neutron number (N)?
5. What are isobars?
6. What is mass defect?
7. What is binding energy?
8. what is radioactivity?
9. What is radioactive constant?
10. What is half life period?
11. What is artificial transmutation?
Radioactivity:
isotopes and isobars;
Properties of alpha, beta and gamma rays;
Kinetics of radioactive decay (decay series excluded), carbon dating;
Stability of nuclei with respect to proton-neutron ratio;
Brief discussion on fission and fusion reactions.
-------------
1. Isotopes have same atomic number. State True or false.
2. What is atomic number(Z)?
3. what is Mass Number (A)?
4. What is neutron number (N)?
5. What are isobars?
6. What is mass defect?
7. What is binding energy?
8. what is radioactivity?
9. What is radioactive constant?
10. What is half life period?
11. What is artificial transmutation?
IIT JEE Chemistry Questions Ch.13. NON-METALS
JEE Syllabus
Isolation/preparation and properties of the following non-metals:
Boron,
silicon,
nitrogen,
phosphorus,
oxygen,
sulphur and
halogens;
Properties of allotropes of
carbon (only diamond and graphite),
phosphorus and
sulphur.
Isolation/preparation and properties of the following non-metals:
Boron,
silicon,
nitrogen,
phosphorus,
oxygen,
sulphur and
halogens;
Properties of allotropes of
carbon (only diamond and graphite),
phosphorus and
sulphur.
IIT JEE Chemistry Questions Ch.14. COMPOUNDS OF METALS
JEE Syllabus
Preparation and properties of the following compounds:
Oxides,
peroxides,
hydroxides,
carbonates,
bicarbonates,
chlorides and
sulphates of
sodium,
potassium,
magnesium and
calcium;
Aluminium:
alumina,
aluminium chloride and
alums;
Preparation and properties of the following compounds:
Oxides,
peroxides,
hydroxides,
carbonates,
bicarbonates,
chlorides and
sulphates of
sodium,
potassium,
magnesium and
calcium;
Aluminium:
alumina,
aluminium chloride and
alums;
IIT JEE Chemistry Questions Ch.15. COMPOUNDS OF NONMETLAS
JEE Syllabus
Preparation and properties of the following compounds:
Carbon: oxides and oxyacid (carbonic acid);
Silicon: silicones, silicates and silicon carbide;
Nitrogen: oxides, oxyacids and ammonia;
Phosphorus: oxides, oxyacids (phosphorus acid, phosphoric acid) and phosphine;
Oxygen: ozone and hydrogen peroxide;
Sulphur: hydrogen sulphide, oxides, sulphurous acid, sulphuric acid and sodium thiosulphate;
Halogens: hydrohalic acids, oxides and oxyacids of chlorine, bleaching powder; Xenon fluorides;
Fertilizers: commercially available (common) NPK type.
-----------------------
Preparation and properties of the following compounds:
Carbon: oxides and oxyacid (carbonic acid);
Silicon: silicones, silicates and silicon carbide;
Nitrogen: oxides, oxyacids and ammonia;
Phosphorus: oxides, oxyacids (phosphorus acid, phosphoric acid) and phosphine;
Oxygen: ozone and hydrogen peroxide;
Sulphur: hydrogen sulphide, oxides, sulphurous acid, sulphuric acid and sodium thiosulphate;
Halogens: hydrohalic acids, oxides and oxyacids of chlorine, bleaching powder; Xenon fluorides;
Fertilizers: commercially available (common) NPK type.
-----------------------
IIT JEE Chemistry Questions Ch.16.Transition Elements
JEE Syllabus
Transition elements (3d series):
Definition, general characteristics, oxidation states and their stabilities, colour (excluding the details of electronic transitions) and calculation of spin-only magnetic moment;
Coordination compounds: nomenclature of mononuclear coordination compounds, cis-trans and ionisation isomerisms, hybridization and geometries of mononuclear coordination compounds (linear, tetrahedral, square planar and octahedral).
Preparation and properties of the following compounds: Oxides and chlorides of tin and lead; Oxides, chlorides and sulphates of Fe2+, Cu2+ and Zn2+; Potassium permanganate, potassium dichromate, silver oxide, silver nitrate, silver thiosulphate.
---------------------------
Transition elements (3d series):
---
16.1 Definition
1. What are transition elements?
2. Zinc is not a transition element strictly. Why?
3. Give the 10 elements in 3d series.
4. The outer electronci configuration of copper is ------------ .
5. The outer electronci configuration of chromium is
---
16.2 general characteristics of 3d series elements
1. Comment on the brittleness and hardness of 3d series elements.
2. Comment on the melting and boiling points and heat of vaporization of 3d series elements.
3. Comment on the densities 3d series elements.
4. Comment on the ionization energies of 3d series elements.
5. Are 3d series elements electropositive or electronegative in general?
6. With respect to colour of compounds what is special about 3d series elements?
6a. What is the colour of zinc compounds?
7. What are complexes and what is the speciality of 3d series elements with respect to this concept?
8. What is an oxidation state and what is the speciality of 3d series elements with respect to this concept?
9. What is paramagnetism and diamagnetism and in general 3d series exhibit which type of magnetism and why?
10. Do 3d series elements form alloys easily? Why?
11. What is an interstitial compound? How is the concept related to 3d series elements?
12. What is a catalyst? Do 3d series elements act as catalysts?
13. Where is V2O5 used as a catalyst?
14. What is the catalyst in Haber Process?
15. Mention the use of nickel as a catalyst?
---
Oxidation states and their stabilities
1. The highest oxidation state of chromium is
2. The highest oxidation state of manganese is
3. The oxidation states exhibited by zinc are
4. the lowest oxidation of chromium is
5. The highest oxidation state of iron is
6. The unstable oxidation states of chromium are
7. The unstable oxidation states of manganese are
8. The unstable oxidation states of iron are
9. The unstable oxidation state of cobalt is
------
Colour (excluding the details of electronic transitions)
1. General the compounds of 3d series elements are coloured. Why?
2. what is colour of Fe(III) ions?
3. what is the colour of Mn(III) ions?
4. what is the colour Zn(II) ions?
5. what is the colour of Co(II) ions?
----
Calculation of spin-only magnetic moment
1. what is the formula for calculating magentic moment?
2. what are the units of magnetic moment?
3. What are ferromagnetic substances?
4. What determines the level of paramagnetic character of an element?
---
------
Coordination compounds:---
Introduction
1. Define coordinate compound.
2. what is a ligand?
3. What are cationnic complex and anionic complex?
4. What coordinate sphere?
5. What are chelate ligands?
6. How do you determine charge of a complex ion?
7. What is coordination number?
---
Nomenclature of mononuclear coordination compounds,
1. IUPAC name of [Fe(CN)-6]^3- ion is
2. The IUPAC name of [Ni(CO)-4] is
3. The IUPAC name of [Ni(CN)4}^2- is
4. IUPAC name of K3[Co(NO2)6] is
5. IUPAC name of [Pt(NH3)4(NO2)Cl]SO4 is
6. IUPAC name of K[Ag(CN)2] is
7. IUPAC name of K4[Fe(CN)6] is
8. IUPAC name of Na2[Fe(CN)5(NO)] is
---
cis-trans isomerism
1. Explain the concept of geometric isomerism or cis-trans isomerism in coordinate compounds.
2. What geometries are adopted by compounds having coordination number 4?
3. Do a coordinate compound having tetrahedral geometry exhibit cis-trans isomerism?
4. Geometrical isomerism is not exhibited by complexes of the type MA-4, MA-3B or MAB-3 (where M = metal, A and B are anionic ligands). Why?
5. Square planar complexs of the type MA-2X-2, MA-2XY, MABX-2, MABXY can exist as geometrical isomers(A,B are neutral and X and Y are anionic ligands). Why?
6. Give five examples of cis-trans isomerism.
---
ionisation isomerisms,
1. Explain what is meant by ionisation isomerism.
2. Explain ionisation isomerism with an example.
3. Give give examples of ionisatin isomerism.
---
hybridization and geometries of mononuclear coordination compounds (linear, tetrahedral, square planar and octahedral).
1. what orbitals are involved in hybridization of central metal ion?
2. State the relatonship between coordination number, hybridization and geometry adopted by the molecules of coordinate compounds.
3. Explain the terms inner orbital complex and outer orbital complex.
4. Explain the terms low spin complex and high spin complex.
---
Transition elements (3d series):
Definition, general characteristics, oxidation states and their stabilities, colour (excluding the details of electronic transitions) and calculation of spin-only magnetic moment;
Coordination compounds: nomenclature of mononuclear coordination compounds, cis-trans and ionisation isomerisms, hybridization and geometries of mononuclear coordination compounds (linear, tetrahedral, square planar and octahedral).
Preparation and properties of the following compounds: Oxides and chlorides of tin and lead; Oxides, chlorides and sulphates of Fe2+, Cu2+ and Zn2+; Potassium permanganate, potassium dichromate, silver oxide, silver nitrate, silver thiosulphate.
---------------------------
Transition elements (3d series):
---
16.1 Definition
1. What are transition elements?
2. Zinc is not a transition element strictly. Why?
3. Give the 10 elements in 3d series.
4. The outer electronci configuration of copper is ------------ .
5. The outer electronci configuration of chromium is
---
16.2 general characteristics of 3d series elements
1. Comment on the brittleness and hardness of 3d series elements.
2. Comment on the melting and boiling points and heat of vaporization of 3d series elements.
3. Comment on the densities 3d series elements.
4. Comment on the ionization energies of 3d series elements.
5. Are 3d series elements electropositive or electronegative in general?
6. With respect to colour of compounds what is special about 3d series elements?
6a. What is the colour of zinc compounds?
7. What are complexes and what is the speciality of 3d series elements with respect to this concept?
8. What is an oxidation state and what is the speciality of 3d series elements with respect to this concept?
9. What is paramagnetism and diamagnetism and in general 3d series exhibit which type of magnetism and why?
10. Do 3d series elements form alloys easily? Why?
11. What is an interstitial compound? How is the concept related to 3d series elements?
12. What is a catalyst? Do 3d series elements act as catalysts?
13. Where is V2O5 used as a catalyst?
14. What is the catalyst in Haber Process?
15. Mention the use of nickel as a catalyst?
---
Oxidation states and their stabilities
1. The highest oxidation state of chromium is
2. The highest oxidation state of manganese is
3. The oxidation states exhibited by zinc are
4. the lowest oxidation of chromium is
5. The highest oxidation state of iron is
6. The unstable oxidation states of chromium are
7. The unstable oxidation states of manganese are
8. The unstable oxidation states of iron are
9. The unstable oxidation state of cobalt is
------
Colour (excluding the details of electronic transitions)
1. General the compounds of 3d series elements are coloured. Why?
2. what is colour of Fe(III) ions?
3. what is the colour of Mn(III) ions?
4. what is the colour Zn(II) ions?
5. what is the colour of Co(II) ions?
----
Calculation of spin-only magnetic moment
1. what is the formula for calculating magentic moment?
2. what are the units of magnetic moment?
3. What are ferromagnetic substances?
4. What determines the level of paramagnetic character of an element?
---
------
Coordination compounds:---
Introduction
1. Define coordinate compound.
2. what is a ligand?
3. What are cationnic complex and anionic complex?
4. What coordinate sphere?
5. What are chelate ligands?
6. How do you determine charge of a complex ion?
7. What is coordination number?
---
Nomenclature of mononuclear coordination compounds,
1. IUPAC name of [Fe(CN)-6]^3- ion is
2. The IUPAC name of [Ni(CO)-4] is
3. The IUPAC name of [Ni(CN)4}^2- is
4. IUPAC name of K3[Co(NO2)6] is
5. IUPAC name of [Pt(NH3)4(NO2)Cl]SO4 is
6. IUPAC name of K[Ag(CN)2] is
7. IUPAC name of K4[Fe(CN)6] is
8. IUPAC name of Na2[Fe(CN)5(NO)] is
---
cis-trans isomerism
1. Explain the concept of geometric isomerism or cis-trans isomerism in coordinate compounds.
2. What geometries are adopted by compounds having coordination number 4?
3. Do a coordinate compound having tetrahedral geometry exhibit cis-trans isomerism?
4. Geometrical isomerism is not exhibited by complexes of the type MA-4, MA-3B or MAB-3 (where M = metal, A and B are anionic ligands). Why?
5. Square planar complexs of the type MA-2X-2, MA-2XY, MABX-2, MABXY can exist as geometrical isomers(A,B are neutral and X and Y are anionic ligands). Why?
6. Give five examples of cis-trans isomerism.
---
ionisation isomerisms,
1. Explain what is meant by ionisation isomerism.
2. Explain ionisation isomerism with an example.
3. Give give examples of ionisatin isomerism.
---
hybridization and geometries of mononuclear coordination compounds (linear, tetrahedral, square planar and octahedral).
1. what orbitals are involved in hybridization of central metal ion?
2. State the relatonship between coordination number, hybridization and geometry adopted by the molecules of coordinate compounds.
3. Explain the terms inner orbital complex and outer orbital complex.
4. Explain the terms low spin complex and high spin complex.
---
IIT JEE Chemistry Questions Ch.17. Ores/Minerals and Extractive Metallury
Ores and minerals:
Commonly occurring ores and minerals of
iron,
copper,
tin,
lead,
magnesium,
aluminium,
zinc and
silver.
Extractive metallurgy: Chemical principles and reactions only (industrial details excluded);
Carbon reduction method (iron and tin);
Self reduction method (copper and lead);
Electrolytic reduction method (magnesium and aluminium);
Cyanide process (silver and gold).
-------------
Commonly occurring ores and minerals of
iron,
copper,
tin,
lead,
magnesium,
aluminium,
zinc and
silver.
Extractive metallurgy: Chemical principles and reactions only (industrial details excluded);
Carbon reduction method (iron and tin);
Self reduction method (copper and lead);
Electrolytic reduction method (magnesium and aluminium);
Cyanide process (silver and gold).
-------------
IIT JEE Chemistry Questions Ch 18 Exercises in Inorganic Chemistry
JEE Syllabus
Principles of qualitative analysis: Groups I to V (only Ag+, Hg2+, Cu2+, Pb2+, Bi3+, Fe3+, Cr3+, Al3+, Ca2+, Ba2+, Zn2+, Mn2+ and Mg2+); Nitrate, halides (excluding fluoride), sulphate, sulphide and sulphite.
Principles of qualitative analysis: Groups I to V (only Ag+, Hg2+, Cu2+, Pb2+, Bi3+, Fe3+, Cr3+, Al3+, Ca2+, Ba2+, Zn2+, Mn2+ and Mg2+); Nitrate, halides (excluding fluoride), sulphate, sulphide and sulphite.
IIT JEE Chemistry Questions 19. Hybridization, Isomerism
Hybridisation of carbon;
Sigma and pi-bonds;
Shapes of simple organic molecules;
Structural isomerism
Conformations of ethane and butane (Newman projections);
geometrical isomerism;
Conformations of ethane and butane (Newman projections);
Optical isomerism of compounds containing up to two asymmetric centres, (R,S and E,Z nomenclature excluded);
IUPAC nomenclature of simple organic compounds (only hydrocarbons, mono-functional and bi-functional compounds);
------------------
1. What is the distance between two adjacent carbon atoms in ethane? Compare it with the distance between the same in ethene?
2. Name an isomer of diethyl ether?
3. Whatis the maximum number of isomers for an alkene C-4H-8?
4. What is dipole moment?
5. What is cis-trans isomerism?
6. What is the structural formula for 3,3-dimethyl-1-butene?
7. What is the structural formula for 3,3-dimethyl-1-butene?
8. If two compounds have same empirical formula, but different molecular formulae, what characteristics will be different?
9. What is the number of isomers c-6H-14 has?
10. What the Cl-C-Cl angle in tetrachloromethane?
11. What are the number of structural and configurational isomers of a bromo compound C-5H-9Br? How do you produce it?
12. what is keto-enol tautomerism?
13. give an example of keto-enol tautomerism.
14. What is the number of sigma and pi bonds in 1-butene-3-yne?
15. What is chirality?
16. What is a chiral carbon?
17. What is an asymmetric carbon?
18. What are conformers (conformation isomers)?
19. What is metamerism?
20. What tautomerism?
21. what are isomers?
22. What are stereo isomers?
23. what are enantiomers?
24. How can you separate two enantiomers?
25. Name some compounds that show optical activity.
26. what is the relationship between mesotartaric acid and d-tartaric acid in terms of isomerism?
27.What are axis of symmetry and centre of symmetry?
28. When do you say a molecule is chiral?
29. Whar is the number of isomers that C-7H-16 has?
30.What is a meso compound?
Sigma and pi-bonds;
Shapes of simple organic molecules;
Structural isomerism
Conformations of ethane and butane (Newman projections);
geometrical isomerism;
Conformations of ethane and butane (Newman projections);
Optical isomerism of compounds containing up to two asymmetric centres, (R,S and E,Z nomenclature excluded);
IUPAC nomenclature of simple organic compounds (only hydrocarbons, mono-functional and bi-functional compounds);
------------------
1. What is the distance between two adjacent carbon atoms in ethane? Compare it with the distance between the same in ethene?
2. Name an isomer of diethyl ether?
3. Whatis the maximum number of isomers for an alkene C-4H-8?
4. What is dipole moment?
5. What is cis-trans isomerism?
6. What is the structural formula for 3,3-dimethyl-1-butene?
7. What is the structural formula for 3,3-dimethyl-1-butene?
8. If two compounds have same empirical formula, but different molecular formulae, what characteristics will be different?
9. What is the number of isomers c-6H-14 has?
10. What the Cl-C-Cl angle in tetrachloromethane?
11. What are the number of structural and configurational isomers of a bromo compound C-5H-9Br? How do you produce it?
12. what is keto-enol tautomerism?
13. give an example of keto-enol tautomerism.
14. What is the number of sigma and pi bonds in 1-butene-3-yne?
15. What is chirality?
16. What is a chiral carbon?
17. What is an asymmetric carbon?
18. What are conformers (conformation isomers)?
19. What is metamerism?
20. What tautomerism?
21. what are isomers?
22. What are stereo isomers?
23. what are enantiomers?
24. How can you separate two enantiomers?
25. Name some compounds that show optical activity.
26. what is the relationship between mesotartaric acid and d-tartaric acid in terms of isomerism?
27.What are axis of symmetry and centre of symmetry?
28. When do you say a molecule is chiral?
29. Whar is the number of isomers that C-7H-16 has?
30.What is a meso compound?
IIT JEE Chemistry Questions 20. Inductive and Resonance Effects
Resonance and hyperconjugation;
Keto-enol tautomerism;
Determination of empirical and molecular formulae of simple compounds (only combustion method);
Hydrogen bonds: definition and their effects on physical properties of alcohols and carboxylic acids;
Inductive and resonance effects on acidity and basicity of organic acids and bases; Polarity and inductive effects in alkyl halides;
Reactive intermediates produced during homolytic and heterolytic bond cleavage; Formation, structure and stability of carbocations, carbanions and free radicals.
Keto-enol tautomerism;
Determination of empirical and molecular formulae of simple compounds (only combustion method);
Hydrogen bonds: definition and their effects on physical properties of alcohols and carboxylic acids;
Inductive and resonance effects on acidity and basicity of organic acids and bases; Polarity and inductive effects in alkyl halides;
Reactive intermediates produced during homolytic and heterolytic bond cleavage; Formation, structure and stability of carbocations, carbanions and free radicals.
IIT JEE Chemistry Questions 21. Alkanes
Preparation, properties and reactions of alkanes:
Homologous series,
physical properties of alkanes (melting points, boiling points and density); Combustion and halogenation of alkanes;
Preparation of alkanes by Wurtz reaction and decarboxylation reactions.
------------------
1. What happens to boiling point of alkanes as molecular mass increases?
2. What happens to boiling point of branched isomers of alkanes?
3. Under what conditions does monochlorination of methane take place?
4. What is the `reaction in Kolbe Electrolytic method of preparing alkanes?
5. What are the reactants and products in hydrolysis of Grignard reagent?
6. In the case of halogenation of alkanes, what is order of reactivity among chlorine, fluorine, and bromine?
7. At ordinary temperatures, why is ultraviolet radiation required to initiate a reaction between halogens and alkanes?
8. What do you understand by 1 degree H, 2 degree H and 3 degree H?
9. What is the difference in reactions between an alkane and fluorine and an alkane and bromine?
10. What is the major product in reaction between bromine and n-butane?
11. What are the products of reaction between n-butane and chlorine at room temperature and sunlight?
12. How do you get iso-butane from n-butane?
13. When do you get aromatic compounds from alkanes?
14. What is the more common name of Methane?
15. What is % composition of Methane in coal gas?
16. How do you produce methane from aluminium chloride?
17. What are the reactants and products of Wurtz reaction?
Answer these questions. This will help you to answer other complex ways of asking questions like MCQs, multiple matching, passage based questions and fact & cause questions.
--------------
Homologous series,
physical properties of alkanes (melting points, boiling points and density); Combustion and halogenation of alkanes;
Preparation of alkanes by Wurtz reaction and decarboxylation reactions.
------------------
1. What happens to boiling point of alkanes as molecular mass increases?
2. What happens to boiling point of branched isomers of alkanes?
3. Under what conditions does monochlorination of methane take place?
4. What is the `reaction in Kolbe Electrolytic method of preparing alkanes?
5. What are the reactants and products in hydrolysis of Grignard reagent?
6. In the case of halogenation of alkanes, what is order of reactivity among chlorine, fluorine, and bromine?
7. At ordinary temperatures, why is ultraviolet radiation required to initiate a reaction between halogens and alkanes?
8. What do you understand by 1 degree H, 2 degree H and 3 degree H?
9. What is the difference in reactions between an alkane and fluorine and an alkane and bromine?
10. What is the major product in reaction between bromine and n-butane?
11. What are the products of reaction between n-butane and chlorine at room temperature and sunlight?
12. How do you get iso-butane from n-butane?
13. When do you get aromatic compounds from alkanes?
14. What is the more common name of Methane?
15. What is % composition of Methane in coal gas?
16. How do you produce methane from aluminium chloride?
17. What are the reactants and products of Wurtz reaction?
Answer these questions. This will help you to answer other complex ways of asking questions like MCQs, multiple matching, passage based questions and fact & cause questions.
--------------
IIT JEE Chemistry Questions 22. Alkenes
Preparation, properties and reactions of alkenes:
Physical properties: boiling points, density and dipole moments
Acidity; Acid catalysed hydration of alkenes(excluding the stereochemistry of addition and elimination);
Reactions of alkenes with KMnO4 and ozone;
Reduction of alkenes;
Preparation of alkenes by elimination reactions;
Electrophilic addition reactions of alkenes with X2, HX, HOX and H2O (X=halogen);
----------------------
1. About alkenes
1. What are alkenes?
2. What is the general formula of alkenes?
3. What is the simplest alkene?
4. What are the bonds in carbon-carbon double bonds (pi and sigma bonds)?
5. What is the carbon-carbon bond length ethene?
2. Nomenclature
3. Isomerism in alekenes
4. Stability of alkenes
5. Preparation of alkenes
1. How do you prepare alkenes from alcohols?
2. How do you prepare alkens from alkyl halides?
3. How do you prepare alkens from vicinal dihalides?
4. How do you prepare alkens from alkynes?
5. How do you prepare alkens from potassium salts of dicarboxylic acids?
6. Physical properties
1. Which alkenes are gases at room temperature?
2. Which alkenes are liquids at room temperature?
3. Which alkenes are solids at room temperature?
4. Compare melting points of alkenes with that of alkanes.
5. Compare melting points of trans-alkens with cis-alkenes.
Physical properties: boiling points, density and dipole moments
Acidity; Acid catalysed hydration of alkenes(excluding the stereochemistry of addition and elimination);
Reactions of alkenes with KMnO4 and ozone;
Reduction of alkenes;
Preparation of alkenes by elimination reactions;
Electrophilic addition reactions of alkenes with X2, HX, HOX and H2O (X=halogen);
----------------------
1. About alkenes
1. What are alkenes?
2. What is the general formula of alkenes?
3. What is the simplest alkene?
4. What are the bonds in carbon-carbon double bonds (pi and sigma bonds)?
5. What is the carbon-carbon bond length ethene?
2. Nomenclature
3. Isomerism in alekenes
4. Stability of alkenes
5. Preparation of alkenes
1. How do you prepare alkenes from alcohols?
2. How do you prepare alkens from alkyl halides?
3. How do you prepare alkens from vicinal dihalides?
4. How do you prepare alkens from alkynes?
5. How do you prepare alkens from potassium salts of dicarboxylic acids?
6. Physical properties
1. Which alkenes are gases at room temperature?
2. Which alkenes are liquids at room temperature?
3. Which alkenes are solids at room temperature?
4. Compare melting points of alkenes with that of alkanes.
5. Compare melting points of trans-alkens with cis-alkenes.
IIT JEE Chemistry Questions 23. Alkynes
Preparation, properties and reactions of alkynes:
Physical properties of alkynes (boiling points, density and dipole moments);
Acidity of alkynes;
Acid catalysed hydration of alkynes (excluding the stereochemistry of addition and elimination);
Reduction of alkynes;
Preparation of alkynes by elimination reactions;
Addition reactions of alkynes;
Metal acetylides.
--------------
On methods of preparation
1. what is produced by hydrolysis of Calcium carbide?
2. What is produced by hydrolysis of magnesium carbide?
3. Name the potassium salt used to produce acetylene in Kolbe's electrolytic method.
4. what is the first stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
5. what is the second stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
6. what do you get in the first stage after reaction of 1,1 -dibromopentane with KOH(alc)?
7. How do you get ethyne from iodoform?
8. How do you get ethyne from chloroform?
9. what do you get by hydrolysis of Aluminium carbide?
10. which gaseous hydrocarbon is produced when calcium carbide reacts with water?
-------------
Simple questions on reactions of Alkynes
1. When propyne is treated with acqeous H-2SO-4 in the presence of HgSO-4, which ketone is formed?
2. Which hydrocarbon contains acidic hydrogen?
3. Give bases stronger and weaker acetylene?
4. Give acids stronger than and weaker than acetylene?
5. To add water to a triple bond what other chemicals are required?
6. When R’MgBr reacts with RC- triple bond-CH, what alkane will result?
7. What are the products of ozonolysis of triple bond (alkyne)?
8. What is the output when ethyne is passed through hot iron tube at 400 degrees Celsius?
9. What is Lindlar’s catalyst?
10. Which alkene will emerge when alkyne is reduced with Lindlar’s catalyst?
11. Which alkene will emerge when alkyne is reduced with lithium metal in liquid ammonia solvent?
12. Among alkynes and alkenes, which are more reactive to halogens? Why?
13. What is the product obtained by adding water to 1-butyne in the presence of required catalysts? What are the catalysts?
14. What are tautomers?
15. What is final the output of polymerization of acetylene? What are intermediate outputs?
16. What are alkadienes?
17. What do you get by adding H-2 to 2-butyne? Give the two alternatives due to difference in reducing agents.
--------------------
Physical properties of alkynes (boiling points, density and dipole moments);
Acidity of alkynes;
Acid catalysed hydration of alkynes (excluding the stereochemistry of addition and elimination);
Reduction of alkynes;
Preparation of alkynes by elimination reactions;
Addition reactions of alkynes;
Metal acetylides.
--------------
On methods of preparation
1. what is produced by hydrolysis of Calcium carbide?
2. What is produced by hydrolysis of magnesium carbide?
3. Name the potassium salt used to produce acetylene in Kolbe's electrolytic method.
4. what is the first stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
5. what is the second stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
6. what do you get in the first stage after reaction of 1,1 -dibromopentane with KOH(alc)?
7. How do you get ethyne from iodoform?
8. How do you get ethyne from chloroform?
9. what do you get by hydrolysis of Aluminium carbide?
10. which gaseous hydrocarbon is produced when calcium carbide reacts with water?
-------------
Simple questions on reactions of Alkynes
1. When propyne is treated with acqeous H-2SO-4 in the presence of HgSO-4, which ketone is formed?
2. Which hydrocarbon contains acidic hydrogen?
3. Give bases stronger and weaker acetylene?
4. Give acids stronger than and weaker than acetylene?
5. To add water to a triple bond what other chemicals are required?
6. When R’MgBr reacts with RC- triple bond-CH, what alkane will result?
7. What are the products of ozonolysis of triple bond (alkyne)?
8. What is the output when ethyne is passed through hot iron tube at 400 degrees Celsius?
9. What is Lindlar’s catalyst?
10. Which alkene will emerge when alkyne is reduced with Lindlar’s catalyst?
11. Which alkene will emerge when alkyne is reduced with lithium metal in liquid ammonia solvent?
12. Among alkynes and alkenes, which are more reactive to halogens? Why?
13. What is the product obtained by adding water to 1-butyne in the presence of required catalysts? What are the catalysts?
14. What are tautomers?
15. What is final the output of polymerization of acetylene? What are intermediate outputs?
16. What are alkadienes?
17. What do you get by adding H-2 to 2-butyne? Give the two alternatives due to difference in reducing agents.
--------------------
IIT JEE Chemistry Questions 24. Benzene
Preparation, properties
Reactions of benzene:
Structure and aromaticity;
Electrophilic substitution reactions:
halogenation, nitration, sulphonation, Friedel-Crafts alkylation and acylation; Effect of o-, m- and p-directing groups in monosubstituted benzenes.
----------
Reactions of benzene:
Structure and aromaticity;
Electrophilic substitution reactions:
halogenation, nitration, sulphonation, Friedel-Crafts alkylation and acylation; Effect of o-, m- and p-directing groups in monosubstituted benzenes.
----------
IIT JEE Chemistry Questions 25. Alcohols
Preparation, properties and reactions
Alcohols:
Preparation, properties and reactions
Speically highlighted topics
esterification,
dehydration and oxidation,
reaction with sodium, phosphorus halides,
reaction with ZnCl2/concentrated HCl,
conversion of alcohols into aldehydes and ketones;
Ethers:Preparation by Williamson's Synthesis;
----------------
25.A Alcohols: Introduction Preparation
1. What are alcohols?
2. What are the classification of alcohols?
3. What are the classifications of monohydric alcohols?
4. Give five examples of secondary alcohols.
25. B Alcohols: Nomenclature
1. What are the IUPAC rules?
2. Name some IUPAC names and common names for alcohols.
25.C Isomers
1. Which types of isomerism is exhibited by alcohols?
2. What is chain isomerism? give some examples of alcohols that exhibit this imomerism.
3. What is position isomerism? Give some examples of alcohols that exhibit this isomerism.
4. What is functional isomerism? Give some examples of alcohols that exhibit this isomerism.
25.D Alcohols: Preparation - General Methods
1. How do you prepare alcohols from haloalkanes?
2. How do you prepare alcohols from aldehydes, ketones and esters?
3. How do you prepare alcohols from Grignard reagents?
4. How do you prepare alcohols from esters?
5. How do you prepare alcohols from alkenes?
6. How do you prepare alcohols from amines?
7. How do you prepare alcohols from tertiary alcohols from ketones?
8. How do you prepare alcohols from secondary alcohols from aldehydes?
9. Explain hydroboration-oxidation-reduction method of preparing alcohols.
10. Explain oxymercuration-reduction method of preparing alcohols.
25. E Alcohols: Preparation - Industrial Methods
1. Explain the method of hydration of alkenes.
2. Explain the oxo process.
3. Explain the process of obtaining ethanol from sugar solution.
4. Explina the process of getting ethanol from starch.
5. How is methanol prepared.
25.F Physical properties
1. What alcohols are liquids and what are solids?
2. How boiling point change with increase in molecular weight?
3. Between n-Butyl alcohol and iso-butyl alcohol which will have higher boiling point and why?
4. Alcohols have higher boiling points compared to other organic compounds having similar molecular masses. Give an example and explain the reason.
5. Are alcohols soluble in water? Explain your answer.
6. What happens to solubility in water in isomerica alcohols?
7. Compare density of alcohols with that of water?
8. Which alcohol is suitable for drinking of intoxicating effects?
25.G Chemical Properties
1.What happens in reaction of alcohols with metals?
2. How does the acidic character of alcohol change over primary, secondary and tertiary alcohols?
3. What happens in reaction of alcohols with metal hydrides?
4. What happens in reaction of alcohols with carboxylic acids?
5. What happens in reaction of alcohols with Grignard reagent?
6. What happens in reaction of alcohols with acyl chloride?
7.What happens in reaction of alcohols with acid anhydride?
8. In the case of reactions involving cleavage of carbon-oxygen bond, what is the order of reactivity among various monohydric alcohols?
9. What happens in reaction of alcohols with hydrogen halides?
10. What happens in reaction of alcohols with phosphorus halides?
11. What happens in reaction of alcohols with thionyl chloride.
12. What happens in acidic dehydration of alcohols?
13. How can you dehydrate alcohols without using acids?
14. How can you oxidize alcohols and what products come out of it?
15. What is dehydrogenation of alcohols?
16. How do you get alkenes from alcohols by dehydrogenation?
dehydration and oxidation,
reaction with sodium, phosphorus halides,
reaction with ZnCl2/concentrated HCl,
conversion of alcohols into aldehydes and ketones;
Ethers:Preparation by Williamson's Synthesis;
25. H esterification,
1. What happens in reaction of alcohols with carboxylic acids?
2. What is esterification?
3. What is the function of H2SO4 in esterification?
4. What is Fischer-Speier esterification?
5. Why is it difficult to prepare esters of tertiary alcohol?
6. Esterification cleaves O-H bond. How was it proved?
7. Name 5 esters.
25 I Dehydration
1. Dehydration involves cleaving of alkyl and hydroxyl groups. Explain the statement with an example.
2. What is acidic dehydration of alcohols?
3. What is the reaction mechanism of acidic dehydration?
4. What is the ease of dehydration of alcohols in monohydric alcohols?
5. When do you get ethene as product in acidic dehydration of alcohols?
6. When do you get ether as product in acidic dehydration of alcohols?
7. When do you get ethyl hydrogen sulphate as product in acidic dehydration of alcohols?
8. When is carbocation formed in acidic dehydration of alcohols?
9. How do you dehydrate alcohols without using acids?
10.What product do you get when you dehydrate alcohols at 633K over heated alumina catalyst?
25 J oxidation
1. what are the reagents used for oxidation of alcohols?
2. Explain what happens in oxidation of primary alcohols?
3. Explain what happens in oxidation of secondary alcohols?
4. Explain what happens in oxidation of tertiary alcohols?
25 K reaction with sodium
1. Explain the products of reaction between ethanol and sodium.
25 L phosphorus halides
1. Explain the products of reaction between phosphorus halides and alcohols.
2. What are the products reaction btween ethanol and PCl5?
3. What are the products reaction btween ethanol and PCl3?
4. What are the products reaction btween ethanol and PBr5?
5. What are the products reaction btween ethanol and PI3?
6. How are PB3 and PI3 prepared for this reaction?
25 M Reaction with ZnCl2/concentrated HCl
1. what is Lucas reagent?
2. How do you use Lucas test for distinguishing various alcohols?
25 N conversion of alcohols into aldehydes and ketones;
1. How do you get aldehydes from alcohols?
2. How do you get ketones from alcohols?
25 O Ethers:Preparation by Williamson's Synthesis;
25-P. More questions across topics
1. Which type of alcohols react fastest with Lucas reagent at room temperature?
2. How do you prepare methanol industrially?
3. Is 2-methylpropan-2-ol a teriary alcohol?
4. How do you prepare methyl ethyl ketone?
5. How do you prepare butanonitrile?
6. Out of primary, secondary and tertiary alcohols, which ones have minimum boiling point?
7.What is the order of reactivity of HX towards ROH?
8. What is the order of reactivity of various degrees of alcohols with HX?
9. what are the products of dehydration of 1-butanol? What is the main product?
10. What is the reactivity of various degrees of alcohol with active metals?
11. What is the relative reactivity of alcohols in comparison to water and ethyne?
12. How do you change a 1 degree alcohol into 1 degree aldehyde?
13. In the Victor Meyer test which type of alcohols show blue colouration?
14. what is Lucas reagent?
15. Which type of alcohols do not react with Lucas reagent?
16. What is glycerine? Is it a alcohol?
17. In the Victor Meyer test which type of alcohols show red colouration?
18. In the Lucas test, how do you identify alcohols?
19. What do you get when vapours of 2-propanol are passed hot metallic Cu at 570 K?
Alcohols:
Preparation, properties and reactions
Speically highlighted topics
esterification,
dehydration and oxidation,
reaction with sodium, phosphorus halides,
reaction with ZnCl2/concentrated HCl,
conversion of alcohols into aldehydes and ketones;
Ethers:Preparation by Williamson's Synthesis;
----------------
25.A Alcohols: Introduction Preparation
1. What are alcohols?
2. What are the classification of alcohols?
3. What are the classifications of monohydric alcohols?
4. Give five examples of secondary alcohols.
25. B Alcohols: Nomenclature
1. What are the IUPAC rules?
2. Name some IUPAC names and common names for alcohols.
25.C Isomers
1. Which types of isomerism is exhibited by alcohols?
2. What is chain isomerism? give some examples of alcohols that exhibit this imomerism.
3. What is position isomerism? Give some examples of alcohols that exhibit this isomerism.
4. What is functional isomerism? Give some examples of alcohols that exhibit this isomerism.
25.D Alcohols: Preparation - General Methods
1. How do you prepare alcohols from haloalkanes?
2. How do you prepare alcohols from aldehydes, ketones and esters?
3. How do you prepare alcohols from Grignard reagents?
4. How do you prepare alcohols from esters?
5. How do you prepare alcohols from alkenes?
6. How do you prepare alcohols from amines?
7. How do you prepare alcohols from tertiary alcohols from ketones?
8. How do you prepare alcohols from secondary alcohols from aldehydes?
9. Explain hydroboration-oxidation-reduction method of preparing alcohols.
10. Explain oxymercuration-reduction method of preparing alcohols.
25. E Alcohols: Preparation - Industrial Methods
1. Explain the method of hydration of alkenes.
2. Explain the oxo process.
3. Explain the process of obtaining ethanol from sugar solution.
4. Explina the process of getting ethanol from starch.
5. How is methanol prepared.
25.F Physical properties
1. What alcohols are liquids and what are solids?
2. How boiling point change with increase in molecular weight?
3. Between n-Butyl alcohol and iso-butyl alcohol which will have higher boiling point and why?
4. Alcohols have higher boiling points compared to other organic compounds having similar molecular masses. Give an example and explain the reason.
5. Are alcohols soluble in water? Explain your answer.
6. What happens to solubility in water in isomerica alcohols?
7. Compare density of alcohols with that of water?
8. Which alcohol is suitable for drinking of intoxicating effects?
25.G Chemical Properties
1.What happens in reaction of alcohols with metals?
2. How does the acidic character of alcohol change over primary, secondary and tertiary alcohols?
3. What happens in reaction of alcohols with metal hydrides?
4. What happens in reaction of alcohols with carboxylic acids?
5. What happens in reaction of alcohols with Grignard reagent?
6. What happens in reaction of alcohols with acyl chloride?
7.What happens in reaction of alcohols with acid anhydride?
8. In the case of reactions involving cleavage of carbon-oxygen bond, what is the order of reactivity among various monohydric alcohols?
9. What happens in reaction of alcohols with hydrogen halides?
10. What happens in reaction of alcohols with phosphorus halides?
11. What happens in reaction of alcohols with thionyl chloride.
12. What happens in acidic dehydration of alcohols?
13. How can you dehydrate alcohols without using acids?
14. How can you oxidize alcohols and what products come out of it?
15. What is dehydrogenation of alcohols?
16. How do you get alkenes from alcohols by dehydrogenation?
dehydration and oxidation,
reaction with sodium, phosphorus halides,
reaction with ZnCl2/concentrated HCl,
conversion of alcohols into aldehydes and ketones;
Ethers:Preparation by Williamson's Synthesis;
25. H esterification,
1. What happens in reaction of alcohols with carboxylic acids?
2. What is esterification?
3. What is the function of H2SO4 in esterification?
4. What is Fischer-Speier esterification?
5. Why is it difficult to prepare esters of tertiary alcohol?
6. Esterification cleaves O-H bond. How was it proved?
7. Name 5 esters.
25 I Dehydration
1. Dehydration involves cleaving of alkyl and hydroxyl groups. Explain the statement with an example.
2. What is acidic dehydration of alcohols?
3. What is the reaction mechanism of acidic dehydration?
4. What is the ease of dehydration of alcohols in monohydric alcohols?
5. When do you get ethene as product in acidic dehydration of alcohols?
6. When do you get ether as product in acidic dehydration of alcohols?
7. When do you get ethyl hydrogen sulphate as product in acidic dehydration of alcohols?
8. When is carbocation formed in acidic dehydration of alcohols?
9. How do you dehydrate alcohols without using acids?
10.What product do you get when you dehydrate alcohols at 633K over heated alumina catalyst?
25 J oxidation
1. what are the reagents used for oxidation of alcohols?
2. Explain what happens in oxidation of primary alcohols?
3. Explain what happens in oxidation of secondary alcohols?
4. Explain what happens in oxidation of tertiary alcohols?
25 K reaction with sodium
1. Explain the products of reaction between ethanol and sodium.
25 L phosphorus halides
1. Explain the products of reaction between phosphorus halides and alcohols.
2. What are the products reaction btween ethanol and PCl5?
3. What are the products reaction btween ethanol and PCl3?
4. What are the products reaction btween ethanol and PBr5?
5. What are the products reaction btween ethanol and PI3?
6. How are PB3 and PI3 prepared for this reaction?
25 M Reaction with ZnCl2/concentrated HCl
1. what is Lucas reagent?
2. How do you use Lucas test for distinguishing various alcohols?
25 N conversion of alcohols into aldehydes and ketones;
1. How do you get aldehydes from alcohols?
2. How do you get ketones from alcohols?
25 O Ethers:Preparation by Williamson's Synthesis;
25-P. More questions across topics
1. Which type of alcohols react fastest with Lucas reagent at room temperature?
2. How do you prepare methanol industrially?
3. Is 2-methylpropan-2-ol a teriary alcohol?
4. How do you prepare methyl ethyl ketone?
5. How do you prepare butanonitrile?
6. Out of primary, secondary and tertiary alcohols, which ones have minimum boiling point?
7.What is the order of reactivity of HX towards ROH?
8. What is the order of reactivity of various degrees of alcohols with HX?
9. what are the products of dehydration of 1-butanol? What is the main product?
10. What is the reactivity of various degrees of alcohol with active metals?
11. What is the relative reactivity of alcohols in comparison to water and ethyne?
12. How do you change a 1 degree alcohol into 1 degree aldehyde?
13. In the Victor Meyer test which type of alcohols show blue colouration?
14. what is Lucas reagent?
15. Which type of alcohols do not react with Lucas reagent?
16. What is glycerine? Is it a alcohol?
17. In the Victor Meyer test which type of alcohols show red colouration?
18. In the Lucas test, how do you identify alcohols?
19. What do you get when vapours of 2-propanol are passed hot metallic Cu at 570 K?
IIT JEE Chemistry Questions 26. Alkyl and Aryl Halides
Preparation, properties and reactions
Alkyl halides: rearrangement reactions of alkyl carbocation, Grignard reactions, nucleophilic substitution reactions;
-----------------------
1. Is the C-X bond in alkyl halides polar?
2. How does the bond strength change with increasing size of halogen atoms?
3 Between alkyl halides and corresponding alkanes whose boiling point is more?
4. How does the boiling point of alkyl halide change with size of the halogen atom?
5. How do you produce nitroalkane?
6. How do you produce isocyanide?
7. what is S-N-1 mechanism?
8. What is S-N-2 mechanism?
9. Give an example of converting an alkyl halide to alkene.
10. How do you produce Grignard reagent?
11. How do you prepare aryl halides by Friedel Crafts halogenation?
12. How do you prepare aryl halides by Sandmeyer reaction?
13. what is Schiemann reaction?
14. What is an aryl group?
15. Between aryl halides and alkyl halides which are more reactive to nucleophilic substitutin?
16. What is the major product when 2-bromobutane is treated with ethanolic KOH?
17. How many isomers does dibromobutane has?
18. what are the products of reaction between RMgX and ethyl formate?
19. what are the products of reaction between RMgX and water?
20. What is a Fittig reaction?
21. What does chlorination of toluene with excess of chlorine under the conditions of light and heat produce?
22. Is fluorination of benzene a exothermic reaction?
23. What is Wurtz-Fittig reaction?
24. What is Walden inversion?
25. In the reaction of p-chlorotoluene with KNH-2 in liquor Ammonia, what is the major product?
26. What happens to dipole moment as the size of the halogen atom increases in alkyl halides?
27. What is steric hindrance?
28. Are alkyl chlorides lighter than water?
29. What is Saytzeff rule?
30. What is benzenediazonium chloride?
Alkyl halides: rearrangement reactions of alkyl carbocation, Grignard reactions, nucleophilic substitution reactions;
-----------------------
1. Is the C-X bond in alkyl halides polar?
2. How does the bond strength change with increasing size of halogen atoms?
3 Between alkyl halides and corresponding alkanes whose boiling point is more?
4. How does the boiling point of alkyl halide change with size of the halogen atom?
5. How do you produce nitroalkane?
6. How do you produce isocyanide?
7. what is S-N-1 mechanism?
8. What is S-N-2 mechanism?
9. Give an example of converting an alkyl halide to alkene.
10. How do you produce Grignard reagent?
11. How do you prepare aryl halides by Friedel Crafts halogenation?
12. How do you prepare aryl halides by Sandmeyer reaction?
13. what is Schiemann reaction?
14. What is an aryl group?
15. Between aryl halides and alkyl halides which are more reactive to nucleophilic substitutin?
16. What is the major product when 2-bromobutane is treated with ethanolic KOH?
17. How many isomers does dibromobutane has?
18. what are the products of reaction between RMgX and ethyl formate?
19. what are the products of reaction between RMgX and water?
20. What is a Fittig reaction?
21. What does chlorination of toluene with excess of chlorine under the conditions of light and heat produce?
22. Is fluorination of benzene a exothermic reaction?
23. What is Wurtz-Fittig reaction?
24. What is Walden inversion?
25. In the reaction of p-chlorotoluene with KNH-2 in liquor Ammonia, what is the major product?
26. What happens to dipole moment as the size of the halogen atom increases in alkyl halides?
27. What is steric hindrance?
28. Are alkyl chlorides lighter than water?
29. What is Saytzeff rule?
30. What is benzenediazonium chloride?
IIT JEE Chemistry Questions 27. Aldehydes and Ketones
Preparation, properties and reactions
Aldehydes and Ketones: oxidation, reduction, oxime and hydrazone formation;
aldol condensation, Perkin reaction;
Cannizzaro reaction;
haloform reaction and nucleophilic addition reactions (Grignard addition);
------------
1. what are aldehydes?
2. what are ketones?
3. What is Gatterman reaction?
4. How do you reduce R-COCl to an aldehyde?
5. How do you get an aldehyde from methylbenzene?
6. How do you get ketone from alcohols?
7. What is the state of formalehyde as room temperature?
8. What is formalin?
9. Can you easily oxidize ketones?
10. Can you reduce aldehydes?
11. Can you reduce ketones?
12. What is Clemmensen reduction?
13. What is Wolff-Kishner reduction?
14. What is Cannizzaro reaction?
15. What is tollens reagent?
16.What is Fehling's solution?
17. What is Diels-Alder Reaction
18. What is Keto-Enol Tautomerism?
19 How do you get cyanohydrin from a ketone?
20. Give an example of aldol condensation.
Aldehydes and Ketones: oxidation, reduction, oxime and hydrazone formation;
aldol condensation, Perkin reaction;
Cannizzaro reaction;
haloform reaction and nucleophilic addition reactions (Grignard addition);
------------
1. what are aldehydes?
2. what are ketones?
3. What is Gatterman reaction?
4. How do you reduce R-COCl to an aldehyde?
5. How do you get an aldehyde from methylbenzene?
6. How do you get ketone from alcohols?
7. What is the state of formalehyde as room temperature?
8. What is formalin?
9. Can you easily oxidize ketones?
10. Can you reduce aldehydes?
11. Can you reduce ketones?
12. What is Clemmensen reduction?
13. What is Wolff-Kishner reduction?
14. What is Cannizzaro reaction?
15. What is tollens reagent?
16.What is Fehling's solution?
17. What is Diels-Alder Reaction
18. What is Keto-Enol Tautomerism?
19 How do you get cyanohydrin from a ketone?
20. Give an example of aldol condensation.
IIT JEE Chemistry Questions 28. Carboxylic Acids
Preparation, properties and reactions
Carboxylic acids: formation of esters, acid chlorides and amides, ester hydrolysis;
---------
1. what is a carboxylic acid?
2. How do you prepare a carboxylic acid from primary alcohol?
3. How do you prepare carboxylic acid from alkylbenzene?
4. How do you prepare carboxylic acid from Grignard reagent?
5. How do you prepare carboxylic acid from nitriles?
6. Do the molecules of carboxylic acids exhibit hydrogen bonding?
7. Why is the boiling point of caroxylic acid higher than that of an alcohol of comparable molar mass?
8. why acqueous solutions of caroxylate salts are slightly alkaline?
9. How do you convert carboxylic acid into an ester?
10. How do you convert carboxylic acid into acid chloride?
11. How do you convert carboxylic acid into alcohol?
12. what is Hell-Volhard-Zelinsky reaction?
13. Explain how do you get alkane from sodium salt of carboxylic acid with an example.
14. what happens when you heat a calcium salt of carboxylic acid?
15. How do you get acetic anhydride?
16. What do you get from treatment of an ester with LiAIH-4 followed by acid hydrolysis?
17. Name the reactants that produce benzophenone on heating?
18. what are the differences between acetic acid and formic acid?
what are the products of reaction between formic acid and concentrated sulphuric acid?
19. How do you produce acetaphenone?
20. which compound is synthesized by Hell-Volhard-Zelinsky reaction?
Carboxylic acids: formation of esters, acid chlorides and amides, ester hydrolysis;
---------
1. what is a carboxylic acid?
2. How do you prepare a carboxylic acid from primary alcohol?
3. How do you prepare carboxylic acid from alkylbenzene?
4. How do you prepare carboxylic acid from Grignard reagent?
5. How do you prepare carboxylic acid from nitriles?
6. Do the molecules of carboxylic acids exhibit hydrogen bonding?
7. Why is the boiling point of caroxylic acid higher than that of an alcohol of comparable molar mass?
8. why acqueous solutions of caroxylate salts are slightly alkaline?
9. How do you convert carboxylic acid into an ester?
10. How do you convert carboxylic acid into acid chloride?
11. How do you convert carboxylic acid into alcohol?
12. what is Hell-Volhard-Zelinsky reaction?
13. Explain how do you get alkane from sodium salt of carboxylic acid with an example.
14. what happens when you heat a calcium salt of carboxylic acid?
15. How do you get acetic anhydride?
16. What do you get from treatment of an ester with LiAIH-4 followed by acid hydrolysis?
17. Name the reactants that produce benzophenone on heating?
18. what are the differences between acetic acid and formic acid?
what are the products of reaction between formic acid and concentrated sulphuric acid?
19. How do you produce acetaphenone?
20. which compound is synthesized by Hell-Volhard-Zelinsky reaction?
IIT JEE Chemistry Questions 29. Phenols
Haloarenes: nucleophilic aromatic substitution in haloarenes and substituted haloarenes (excluding Benzyne mechanism and Cine substitution).
-------------
1. What phenol?
2. How is phenol prepared using benzene?
3. What is the action of Bromine water on phenol?
4.How is phenol prepared using benzene sulphonic acid?
5.What is the action of dilute nitirc acid on phenol?
6. How is phenol prepared using chlorobenzene?
7. What is the action of conc. nitric acid in the presence of conc. sulphuric acid on phenol?
8. How is phenol prepared using cumene?
9. What is the action of Bromine in CS-2 on phenol?
10. Give a test distinguish between phenol and ethanol?
11. What is the action of conc. sulphuric acid at different temperatures on phenol?
12. How will you obtain from carbolic acid picric acid?
13. How do you use ferric chloride to distinguish between phenol and alcohol?
14. How will you obtain 2,4,6-tribromophenol from carbolic acid?
15. What are the differences in physical properties among p-nitrophenol, o-nitrophenol and m-nitrophenol?
16.What is williamson synthesis?
17. what is Fries rearrangement?
18. What is the action of nitrous acid on phenol?
19. What is Reimer-Tiemann reaction?
20. What is Schotten-baumann reaction?
21. What do phenols liberate when treated with sodium?
22.Are phenols soluble in sodium bicarbonate solution?
23. what happens when phenol is exposed to air?
24. What is picric acid?
25. What is cresol?
For answers see
http://iit-jee-chemistry-aps.blogspot.com/2007/09/answers-to-sq-ch-29-phenols.html
-------------
1. What phenol?
2. How is phenol prepared using benzene?
3. What is the action of Bromine water on phenol?
4.How is phenol prepared using benzene sulphonic acid?
5.What is the action of dilute nitirc acid on phenol?
6. How is phenol prepared using chlorobenzene?
7. What is the action of conc. nitric acid in the presence of conc. sulphuric acid on phenol?
8. How is phenol prepared using cumene?
9. What is the action of Bromine in CS-2 on phenol?
10. Give a test distinguish between phenol and ethanol?
11. What is the action of conc. sulphuric acid at different temperatures on phenol?
12. How will you obtain from carbolic acid picric acid?
13. How do you use ferric chloride to distinguish between phenol and alcohol?
14. How will you obtain 2,4,6-tribromophenol from carbolic acid?
15. What are the differences in physical properties among p-nitrophenol, o-nitrophenol and m-nitrophenol?
16.What is williamson synthesis?
17. what is Fries rearrangement?
18. What is the action of nitrous acid on phenol?
19. What is Reimer-Tiemann reaction?
20. What is Schotten-baumann reaction?
21. What do phenols liberate when treated with sodium?
22.Are phenols soluble in sodium bicarbonate solution?
23. what happens when phenol is exposed to air?
24. What is picric acid?
25. What is cresol?
For answers see
http://iit-jee-chemistry-aps.blogspot.com/2007/09/answers-to-sq-ch-29-phenols.html
IIT JEE Chemistry Questions 30. Amines
Amines:
Preparation and properties
basicity of substituted anilines and aliphatic amines,
preparation from nitro compounds,
reaction with nitrous acid,
azo coupling reaction of diazonium salts of aromatic amines,
Sandmeyer and related reactions of diazonium salts;
carbylamine reaction;
-------
1. What are Amines?
2. How do you prepare ethylamine?
3.How will you prepare diethyl amine?
4. How is ethyl amine prepared from nitroethane?
5. How will you prepare ethyl amine from acetaldoxime?
6. How will yoo prepare ethalamine from methyl iodide?
7. How do you distinguish primary, secondary and tertiary amines?
8. What are the Differences between primary, secondary and tertiary amines?
9. What is the action of acetyl chloride on primary amines?
10. What is the action of sodium nitrite and hydrochloric acid on ethyl amine?
11. what is the action of nitrous acid in dimethyl amine?
12. Give the structure of 2-propanamine.
13. What is methylation of amines?
14. What is the action of acetic anhydride on Triethyl amine?
15. What is carbalamine test?
16. what is Libermann reaction?
17. what is Gatttermann reaction?
18. What is Hinsberg reagent?
19. what is Hoffmann's method?
20. What is aniline?
21. How do you prepare diazonium salt?
22. What is sandmeyer reaction?
For answers see
http://iit-jee-chemistry-aps.blogspot.com/2007/09/answers-to-sq-ch-30-amines.html
Preparation and properties
basicity of substituted anilines and aliphatic amines,
preparation from nitro compounds,
reaction with nitrous acid,
azo coupling reaction of diazonium salts of aromatic amines,
Sandmeyer and related reactions of diazonium salts;
carbylamine reaction;
-------
1. What are Amines?
2. How do you prepare ethylamine?
3.How will you prepare diethyl amine?
4. How is ethyl amine prepared from nitroethane?
5. How will you prepare ethyl amine from acetaldoxime?
6. How will yoo prepare ethalamine from methyl iodide?
7. How do you distinguish primary, secondary and tertiary amines?
8. What are the Differences between primary, secondary and tertiary amines?
9. What is the action of acetyl chloride on primary amines?
10. What is the action of sodium nitrite and hydrochloric acid on ethyl amine?
11. what is the action of nitrous acid in dimethyl amine?
12. Give the structure of 2-propanamine.
13. What is methylation of amines?
14. What is the action of acetic anhydride on Triethyl amine?
15. What is carbalamine test?
16. what is Libermann reaction?
17. what is Gatttermann reaction?
18. What is Hinsberg reagent?
19. what is Hoffmann's method?
20. What is aniline?
21. How do you prepare diazonium salt?
22. What is sandmeyer reaction?
For answers see
http://iit-jee-chemistry-aps.blogspot.com/2007/09/answers-to-sq-ch-30-amines.html
IIT JEE Chemistry Questions 31. Carbohydrates
Carbohydrates: Classification; mono- and di-saccharides (glucose and sucrose); Oxidation, reduction, glycoside formation and hydrolysis of sucrose.
-----------------
I. Simple Questions
1. what are carbohydrates?
2. How are carbohydrates classified?
3. How is gluco prepared from sucrose?
4. What are monosaccharides?
5. give an example of polysaccharide.
6. Give an example of oligosaccharide.
7. How many stereo isomers a carbohydrate can have?
8. What is a cyclic hemiacetal position?
9. What is Haworth projection?
10. What is Fischer projection?
11. What is chair conformational formula?
12. What are anomers?
13. What is mutarotation?
14. What reactions are supported by reducing sugars?
15. Give two examples of disaccharides.
16. What is invert sugar?
17. what are hydrates of carbon?
18. Give the structure of Ketopentose.
19. give the structure of ketotriose.
20. Give the structure of aldotetrose.
21. Give 5 sugars and rank them in relative order of sweetness.
For answers
www.iit-jee-chemistry-aps.blogspot.com
-----------------
I. Simple Questions
1. what are carbohydrates?
2. How are carbohydrates classified?
3. How is gluco prepared from sucrose?
4. What are monosaccharides?
5. give an example of polysaccharide.
6. Give an example of oligosaccharide.
7. How many stereo isomers a carbohydrate can have?
8. What is a cyclic hemiacetal position?
9. What is Haworth projection?
10. What is Fischer projection?
11. What is chair conformational formula?
12. What are anomers?
13. What is mutarotation?
14. What reactions are supported by reducing sugars?
15. Give two examples of disaccharides.
16. What is invert sugar?
17. what are hydrates of carbon?
18. Give the structure of Ketopentose.
19. give the structure of ketotriose.
20. Give the structure of aldotetrose.
21. Give 5 sugars and rank them in relative order of sweetness.
For answers
www.iit-jee-chemistry-aps.blogspot.com
IIT JEE Chemistry Questions 32. Aminoacids and Peptides
Amino acids and peptides: General structure (only primary structure for peptides) and physical properties.
-----------------
I. simple Questions
1. What are amino acids?
2. What is the link between amino acids and proteins?
3. Give two examples of amino acids with Nonpolar R Group.
4. Give two examples of Amino acids with Polar R Group.
5. Give two examples of amino acids with charged R group.
6. Give two examples of amino acids that cannot be made by human body.
7. What is chiral nature of amino acids?
8. What zwitterion?
9. What is peptide linkage?
10. What is a dipeptide?
11. What is the relation between peptide and protein?
12. What is the simplest amino acid?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
-----------------
I. simple Questions
1. What are amino acids?
2. What is the link between amino acids and proteins?
3. Give two examples of amino acids with Nonpolar R Group.
4. Give two examples of Amino acids with Polar R Group.
5. Give two examples of amino acids with charged R group.
6. Give two examples of amino acids that cannot be made by human body.
7. What is chiral nature of amino acids?
8. What zwitterion?
9. What is peptide linkage?
10. What is a dipeptide?
11. What is the relation between peptide and protein?
12. What is the simplest amino acid?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
IIT JEE Chemistry Questions 33. Polymers
Properties and uses of some important polymers: Natural rubber, cellulose, nylon, teflon and PVC.
---------------
I. Simple Questions
1. What is a polymer?
2. Give two examples of natural polymers.
3. What are homopolymers?
4. What are step-growth polymers?
5. What are chain growth polymers?
6. What are elastomers?
7. Give two examples of fibres.
8. What is a thermoplastic?
9. What is the monomer for polymer polyvinyl acetate?
10. How do you get isomers of Poly(1,3-butadiene) from butadiene?
11. Give two examples of copolymers.
12. What vulcanizatin of rubber?
13. Give tow examples of step growth polymers.
14. How do you get nylon-66 polymer?
15. How do you produce bakelite?
16. What are the monomers of Buna-S polymer?
17. What do you get by polymerisation of caprolactum?
18. What is monomer of teflon?
19. What is monomer of synthetic rubber?
20. What is the monomer of starch?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
---------------
I. Simple Questions
1. What is a polymer?
2. Give two examples of natural polymers.
3. What are homopolymers?
4. What are step-growth polymers?
5. What are chain growth polymers?
6. What are elastomers?
7. Give two examples of fibres.
8. What is a thermoplastic?
9. What is the monomer for polymer polyvinyl acetate?
10. How do you get isomers of Poly(1,3-butadiene) from butadiene?
11. Give two examples of copolymers.
12. What vulcanizatin of rubber?
13. Give tow examples of step growth polymers.
14. How do you get nylon-66 polymer?
15. How do you produce bakelite?
16. What are the monomers of Buna-S polymer?
17. What do you get by polymerisation of caprolactum?
18. What is monomer of teflon?
19. What is monomer of synthetic rubber?
20. What is the monomer of starch?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
IIT JEE Chemistry Questions Ch.34 34. Exercises in Organic Chemistry
Practical organic chemistry:
Detection of elements (N, S, halogens);
Detection and identification of the following functional groups:
hydroxyl (alcoholic and phenolic),
carbonyl (aldehyde and ketone),
carboxyl,
amino and nitro;
Chemical methods of separation of mono-functional organic compounds from binary mixtures.
---------------
Detection of elements (N, S, halogens);
Detection and identification of the following functional groups:
hydroxyl (alcoholic and phenolic),
carbonyl (aldehyde and ketone),
carboxyl,
amino and nitro;
Chemical methods of separation of mono-functional organic compounds from binary mixtures.
---------------
IIT JEE Chemistry Question Bank Straight MCQ
IIT JEE Chemistry Question Bank Straight Multiple Choice Questions
Thursday, September 27, 2007
Thursday, September 20, 2007
Join IIT JEE Orkut community
Join
http://www.orkut.com/Community.aspx?cmm=39291603
IIT-JEE-ACADEMY
if you are a student, parent, family member, faculty, author, book publisher
http://www.orkut.com/Community.aspx?cmm=39291603
IIT-JEE-ACADEMY
if you are a student, parent, family member, faculty, author, book publisher
Tuesday, September 18, 2007
Simple Questions Ch. 33 Polymers Question Bank
1. What is a polymer?
2. Give two examples of natural polymers.
3. What are homopolymers?
4. What are step-growth polymers?
5. What are chain growth polymers?
6. What are elastomers?
7. Give two examples of fibres.
8. What is a thermoplastic?
9. What is the monomer for polymer polyvinyl acetate?
10. How do you get isomers of Poly(1,3-butadiene) from butadiene?
11. Give two examples of copolymers.
12. What vulcanizatin of rubber?
13. Give tow examples of step growth polymers.
14. How do you get nylon-66 polymer?
15. How do you produce bakelite?
16. What are the monomers of Buna-S polymer?
17. What do you get by polymerisation of caprolactum?
18. What is monomer of teflon?
19. What is monomer of synthetic rubber?
20. What is the monomer of starch?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
2. Give two examples of natural polymers.
3. What are homopolymers?
4. What are step-growth polymers?
5. What are chain growth polymers?
6. What are elastomers?
7. Give two examples of fibres.
8. What is a thermoplastic?
9. What is the monomer for polymer polyvinyl acetate?
10. How do you get isomers of Poly(1,3-butadiene) from butadiene?
11. Give two examples of copolymers.
12. What vulcanizatin of rubber?
13. Give tow examples of step growth polymers.
14. How do you get nylon-66 polymer?
15. How do you produce bakelite?
16. What are the monomers of Buna-S polymer?
17. What do you get by polymerisation of caprolactum?
18. What is monomer of teflon?
19. What is monomer of synthetic rubber?
20. What is the monomer of starch?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
Simple Questions Ch. 32 Amino Acids and Peptides Question Bank
1. What are amino acids?
2. What is the link between amino acids and proteins?
3. Give two examples of amino acids with Nonpolar R Group.
4. Give two examples of Amino acids with Polar R Group.
5. Give two examples of amino acids with charged R group.
6. Give two examples of amino acids that cannot be made by human body.
7. What is chiral nature of amino acids?
8. What zwitterion?
9. What is peptide linkage?
10. What is a dipeptide?
11. What is the relation between peptide and protein?
12. What is the simplest amino acid?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
2. What is the link between amino acids and proteins?
3. Give two examples of amino acids with Nonpolar R Group.
4. Give two examples of Amino acids with Polar R Group.
5. Give two examples of amino acids with charged R group.
6. Give two examples of amino acids that cannot be made by human body.
7. What is chiral nature of amino acids?
8. What zwitterion?
9. What is peptide linkage?
10. What is a dipeptide?
11. What is the relation between peptide and protein?
12. What is the simplest amino acid?
First answer the questions yourself using the text book. If required visit www.iit-jee-chemistry-aps.blogspot.com for answers
Simple Questions Ch. 31 Carbohydrates Question Bank
1. what are carbohydrates?
2. How are carbohydrates classified?
3. How is gluco prepared from sucrose?
4. What are monosaccharides?
5. give an example of polysaccharide.
6. Give an example of oligosaccharide.
7. How many stereo isomers a carbohydrate can have?
8. What is a cyclic hemiacetal position?
9. What is Haworth projection?
10. What is Fischer projection?
11. What is chair conformational formula?
12. What are anomers?
13. What is mutarotation?
14. What reactions are supported by reducing sugars?
15. Give two examples of disaccharides.
16. What is invert sugar?
17. what are hydrates of carbon?
18. Give the structure of Ketopentose.
19. give the structure of ketotriose.
20. Give the structure of aldotetrose.
21. Give 5 sugars and rank them in relative order of sweetness.
For answers
www.iit-jee-chemistry-aps.blogspot.com
2. How are carbohydrates classified?
3. How is gluco prepared from sucrose?
4. What are monosaccharides?
5. give an example of polysaccharide.
6. Give an example of oligosaccharide.
7. How many stereo isomers a carbohydrate can have?
8. What is a cyclic hemiacetal position?
9. What is Haworth projection?
10. What is Fischer projection?
11. What is chair conformational formula?
12. What are anomers?
13. What is mutarotation?
14. What reactions are supported by reducing sugars?
15. Give two examples of disaccharides.
16. What is invert sugar?
17. what are hydrates of carbon?
18. Give the structure of Ketopentose.
19. give the structure of ketotriose.
20. Give the structure of aldotetrose.
21. Give 5 sugars and rank them in relative order of sweetness.
For answers
www.iit-jee-chemistry-aps.blogspot.com
Simple Questions Ch. 30 Amines Question Bank
1. What are Amines?
2. How do you prepare ethylamine?
3.How will you prepare diethyl amine?
4. How is ethyl amine prepared from nitroethane?
5. How will you prepare ethyl amine from acetaldoxime?
6. How will yoo prepare ethalamine from methyl iodide?
7. How do you distinguish primary, secondary and tertiary amines?
8. What are the Differences between primary, secondary and tertiary amines?
9. What is the action of acetyl chloride on primary amines?
10. What is the action of sodium nitrite and hydrochloric acid on ethyl amine?
11. what is the action of nitrous acid in dimethyl amine?
12. Give the structure of 2-propanamine.
13. What is methylation of amines?
14. What is the action of acetic anhydride on Triethyl amine?
15. What is carbalamine test?
16. what is Libermann reaction?
17. what is Gatttermann reaction?
18. What is Hinsberg reagent?
19. what is Hoffmann's method?
20. What is aniline?
21. How do you prepare diazonium salt?
22. What is sandmeyer reaction?
2. How do you prepare ethylamine?
3.How will you prepare diethyl amine?
4. How is ethyl amine prepared from nitroethane?
5. How will you prepare ethyl amine from acetaldoxime?
6. How will yoo prepare ethalamine from methyl iodide?
7. How do you distinguish primary, secondary and tertiary amines?
8. What are the Differences between primary, secondary and tertiary amines?
9. What is the action of acetyl chloride on primary amines?
10. What is the action of sodium nitrite and hydrochloric acid on ethyl amine?
11. what is the action of nitrous acid in dimethyl amine?
12. Give the structure of 2-propanamine.
13. What is methylation of amines?
14. What is the action of acetic anhydride on Triethyl amine?
15. What is carbalamine test?
16. what is Libermann reaction?
17. what is Gatttermann reaction?
18. What is Hinsberg reagent?
19. what is Hoffmann's method?
20. What is aniline?
21. How do you prepare diazonium salt?
22. What is sandmeyer reaction?
Monday, September 17, 2007
Simple Questions Ch. 29 Phenols
1. What phenol?
2. How is phenol prepared using benzene?
3. What is the action of Bromine water on phenol?
4.How is phenol prepared using benzene sulphonic acid?
5.What is the action of dilute nitirc acid on phenol?
6. How is phenol prepared using chlorobenzene?
7. What is the action of conc. nitric acid in the presence of conc. sulphuric acid on phenol?
8. How is phenol prepared using cumene?
9. What is the action of Bromine in CS-2 on phenol?
10. Give a test distinguish between phenol and ethanol?
11. What is the action of conc. sulphuric acid at different temperatures on phenol?
12. How will you obtain from carbolic acid picric acid?
13. How do you use ferric chloride to distinguish between phenol and alcohol?
14. How will you obtain 2,4,6-tribromophenol from carbolic acid?
15. What are the differences in physical properties among p-nitrophenol, o-nitrophenol and m-nitrophenol?
16.What is williamson synthesis?
17. what is Fries rearrangement?
18. What is the action of nitrous acid on phenol?
19. What is Reimer-Tiemann reaction?
20. What is Schotten-baumann reaction?
21. What do phenols liberate when treated with sodium?
22.Are phenols soluble in sodium bicarbonate solution?
23. what happens when phenol is exposed to air?
24. What is picric acid?
25. What is cresol?
2. How is phenol prepared using benzene?
3. What is the action of Bromine water on phenol?
4.How is phenol prepared using benzene sulphonic acid?
5.What is the action of dilute nitirc acid on phenol?
6. How is phenol prepared using chlorobenzene?
7. What is the action of conc. nitric acid in the presence of conc. sulphuric acid on phenol?
8. How is phenol prepared using cumene?
9. What is the action of Bromine in CS-2 on phenol?
10. Give a test distinguish between phenol and ethanol?
11. What is the action of conc. sulphuric acid at different temperatures on phenol?
12. How will you obtain from carbolic acid picric acid?
13. How do you use ferric chloride to distinguish between phenol and alcohol?
14. How will you obtain 2,4,6-tribromophenol from carbolic acid?
15. What are the differences in physical properties among p-nitrophenol, o-nitrophenol and m-nitrophenol?
16.What is williamson synthesis?
17. what is Fries rearrangement?
18. What is the action of nitrous acid on phenol?
19. What is Reimer-Tiemann reaction?
20. What is Schotten-baumann reaction?
21. What do phenols liberate when treated with sodium?
22.Are phenols soluble in sodium bicarbonate solution?
23. what happens when phenol is exposed to air?
24. What is picric acid?
25. What is cresol?
Simple Questions Ch. 28 Carboxylic Acids
1. what is a carboxylic acid?
2. How do you prepare a carboxylic acid from primary alcohol?
3. How do you prepare carboxylic acid from alkylbenzene?
4. How do you prepare carboxylic acid from Grignard reagent?
5. How do you prepare carboxylic acid from nitriles?
6. Do the molecules of carboxylic acids exhibit hydrogen bonding?
7. Why is the boiling point of caroxylic acid higher than that of an alcohol of comparable molar mass?
8. why acqueous solutions of caroxylate salts are slightly alkaline?
9. How do you convert carboxylic acid into an ester?
10. How do you convert carboxylic acid into acid chloride?
11. How do you convert carboxylic acid into alcohol?
12. what is Hell-Volhard-Zelinsky reaction?
13. Explain how do you get alkane from sodium salt of carboxylic acid with an example.
14. what happens when you heat a calcium salt of carboxylic acid?
15. How do you get acetic anhydride?
16. What do you get from treatment of an ester with LiAIH-4 followed by acid hydrolysis?
17. Name the reactants that produce benzophenone on heating?
18. what are the differences between acetic acid and formic acid?
what are the products of reaction between formic acid and concentrated sulphuric acid?
19. How do you produce acetaphenone?
20. which compound is synthesized by Hell-Volhard-Zelinsky reaction?
2. How do you prepare a carboxylic acid from primary alcohol?
3. How do you prepare carboxylic acid from alkylbenzene?
4. How do you prepare carboxylic acid from Grignard reagent?
5. How do you prepare carboxylic acid from nitriles?
6. Do the molecules of carboxylic acids exhibit hydrogen bonding?
7. Why is the boiling point of caroxylic acid higher than that of an alcohol of comparable molar mass?
8. why acqueous solutions of caroxylate salts are slightly alkaline?
9. How do you convert carboxylic acid into an ester?
10. How do you convert carboxylic acid into acid chloride?
11. How do you convert carboxylic acid into alcohol?
12. what is Hell-Volhard-Zelinsky reaction?
13. Explain how do you get alkane from sodium salt of carboxylic acid with an example.
14. what happens when you heat a calcium salt of carboxylic acid?
15. How do you get acetic anhydride?
16. What do you get from treatment of an ester with LiAIH-4 followed by acid hydrolysis?
17. Name the reactants that produce benzophenone on heating?
18. what are the differences between acetic acid and formic acid?
what are the products of reaction between formic acid and concentrated sulphuric acid?
19. How do you produce acetaphenone?
20. which compound is synthesized by Hell-Volhard-Zelinsky reaction?
Sunday, September 16, 2007
1. what are aldehydes?
2. what are ketones?
3. What is Gatterman reaction?
4. How do you reduce R-COCl to an aldehyde?
5. How do you get an aldehyde from methylbenzene?
6. How do you get ketone from alcohols?
7. What is the state of formalehyde as room temperature?
8. What is formalin?
9. Can you easily oxidize ketones?
10. Can you reduce aldehydes?
11. Can you reduce ketones?
12. What is Clemmensen reduction?
13. What is Wolff-Kishner reduction?
14. What is Cannizzaro reaction?
15. What is tollens reagent?
16.What is Fehling's solution?
17. What is Diels-Alder Reaction
18. What is Keto-Enol Tautomerism?
19 How do you get cyanohydrin from a ketone?
20. Give an example of aldol condensation.
2. what are ketones?
3. What is Gatterman reaction?
4. How do you reduce R-COCl to an aldehyde?
5. How do you get an aldehyde from methylbenzene?
6. How do you get ketone from alcohols?
7. What is the state of formalehyde as room temperature?
8. What is formalin?
9. Can you easily oxidize ketones?
10. Can you reduce aldehydes?
11. Can you reduce ketones?
12. What is Clemmensen reduction?
13. What is Wolff-Kishner reduction?
14. What is Cannizzaro reaction?
15. What is tollens reagent?
16.What is Fehling's solution?
17. What is Diels-Alder Reaction
18. What is Keto-Enol Tautomerism?
19 How do you get cyanohydrin from a ketone?
20. Give an example of aldol condensation.
Simple Questions Ch. 26 Alkyl and Aryl Halides
1. Is the C-X bond in alkyl halides polar?
2. How does the bond strength change with increasing size of halogen atoms?
3 Between alkyl halides and corresponding alkanes whose boiling point is more?
4. How does the boiling point of alkyl halide change with size of the halogen atom?
5. How do you produce nitroalkane?
6. How do you produce isocyanide?
7. what is S-N-1 mechanism?
8. What is S-N-2 mechanism?
9. Give an example of converting an alkyl halide to alkene.
10. How do you produce Grignard reagent?
11. How do you prepare aryl halides by Friedel Crafts halogenation?
12. How do you prepare aryl halides by Sandmeyer reaction?
13. what is Schiemann reaction?
14. What is an aryl group?
15. Between aryl halides and alkyl halides which are more reactive to nucleophilic substitutin?
16. What is the major product when 2-bromobutane is treated with ethanolic KOH?
17. How many isomers does dibromobutane has?
18. what are the products of reaction between RMgX and ethyl formate?
19. what are the products of reaction between RMgX and water?
20. What is a Fittig reaction?
21. What does chlorination of toluene with excess of chlorine under the conditions of light and heat produce?
22. Is fluorination of benzene a exothermic reaction?
23. What is Wurtz-Fittig reaction?
24. What is Walden inversion?
25. In the reaction of p-chlorotoluene with KNH-2 in liquor Ammonia, what is the major product?
26. What happens to dipole moment as the size of the halogen atom increases in alkyl halides?
27. What is steric hindrance?
28. Are alkyl chlorides lighter than water?
29. What is Saytzeff rule?
30. What is benzenediazonium chloride?
2. How does the bond strength change with increasing size of halogen atoms?
3 Between alkyl halides and corresponding alkanes whose boiling point is more?
4. How does the boiling point of alkyl halide change with size of the halogen atom?
5. How do you produce nitroalkane?
6. How do you produce isocyanide?
7. what is S-N-1 mechanism?
8. What is S-N-2 mechanism?
9. Give an example of converting an alkyl halide to alkene.
10. How do you produce Grignard reagent?
11. How do you prepare aryl halides by Friedel Crafts halogenation?
12. How do you prepare aryl halides by Sandmeyer reaction?
13. what is Schiemann reaction?
14. What is an aryl group?
15. Between aryl halides and alkyl halides which are more reactive to nucleophilic substitutin?
16. What is the major product when 2-bromobutane is treated with ethanolic KOH?
17. How many isomers does dibromobutane has?
18. what are the products of reaction between RMgX and ethyl formate?
19. what are the products of reaction between RMgX and water?
20. What is a Fittig reaction?
21. What does chlorination of toluene with excess of chlorine under the conditions of light and heat produce?
22. Is fluorination of benzene a exothermic reaction?
23. What is Wurtz-Fittig reaction?
24. What is Walden inversion?
25. In the reaction of p-chlorotoluene with KNH-2 in liquor Ammonia, what is the major product?
26. What happens to dipole moment as the size of the halogen atom increases in alkyl halides?
27. What is steric hindrance?
28. Are alkyl chlorides lighter than water?
29. What is Saytzeff rule?
30. What is benzenediazonium chloride?
Simple Questions Ch. 25 Alcohols
1. Which type of alcohols react fastest with Lucas reagent at room temperature?
2. How do you prepare methanol industrially?
3. Is 2-methylpropan-2-ol a teriary alcohol?
4. How do you prepare methyl ethyl ketone?
5. How do you prepare butanonitrile?
6. Out of primary, secondary and tertiary alcohols, which ones have minimum boiling point?
7.What is the order of reactivity of HX towards ROH?
8. What is the order of reactivity of various degrees of alcohols with HX?
9. what are the products of dehydration of 1-butanol? What is the main product?
10. What is the reactivity of various degrees of alcohol with active metals?
11. What is the relative reactivity of alcohols in comparison to water and ethyne?
12. How do you change a 1 degree alcohol into 1 degree aldehyde?
13. In the Victor Meyer test which type of alcohols show blue colouration?
14. what is Lucas reagent?
15. Which type of alcohols do not react with Lucas reagent?
16. What is glycerine? Is it a alcohol?
17. In the Victor Meyer test which type of alcohols show red colouration?
18. In the Lucas test, how do you identify alcohols?
19. What do you get when vapours of 2-propanol are passed hot metallic Cu at 570 K?
2. How do you prepare methanol industrially?
3. Is 2-methylpropan-2-ol a teriary alcohol?
4. How do you prepare methyl ethyl ketone?
5. How do you prepare butanonitrile?
6. Out of primary, secondary and tertiary alcohols, which ones have minimum boiling point?
7.What is the order of reactivity of HX towards ROH?
8. What is the order of reactivity of various degrees of alcohols with HX?
9. what are the products of dehydration of 1-butanol? What is the main product?
10. What is the reactivity of various degrees of alcohol with active metals?
11. What is the relative reactivity of alcohols in comparison to water and ethyne?
12. How do you change a 1 degree alcohol into 1 degree aldehyde?
13. In the Victor Meyer test which type of alcohols show blue colouration?
14. what is Lucas reagent?
15. Which type of alcohols do not react with Lucas reagent?
16. What is glycerine? Is it a alcohol?
17. In the Victor Meyer test which type of alcohols show red colouration?
18. In the Lucas test, how do you identify alcohols?
19. What do you get when vapours of 2-propanol are passed hot metallic Cu at 570 K?
Monday, September 10, 2007
Chapter 19 Simple Questions - Hybridization, Isomerism and Nomenclature
1. What is the distance between two adjacent carbon atoms in ethane? Compare it with the distance between the same in ethene?
2. Name an isomer of diethyl ether?
3. Whatis the maximum number of isomers for an alkene C-4H-8?
4. What is dipole moment?
5. What is cis-trans isomerism?
6. What is the structural formula for 3,3-dimethyl-1-butene?
7. What is the structural formula for 3,3-dimethyl-1-butene?
8. If two compounds have same empirical formula, but different molecular formulae, what characteristics will be different?
9. What is the number of isomers c-6H-14 has?
10. What the Cl-C-Cl angle in tetrachloromethane?
11. What are the number of structural and configurational isomers of a bromo compound C-5H-9Br? How do you produce it?
12. what is keto-enol tautomerism?
13. give an example of keto-enol tautomerism.
14. What is the number of sigma and pi bonds in 1-butene-3-yne?
15. What is chirality?
16. What is a chiral carbon?
17. What is an asymmetric carbon?
18. What are conformers (conformation isomers)?
19. What is metamerism?
20. What tautomerism?
21. what are isomers?
22. What are stereo isomers?
23. what are enantiomers?
24. How can you separate two enantiomers?
25. Name some compounds that show optical activity.
26. what is the relationship between mesotartaric acid and d-tartaric acid in terms of isomerism?
27.What are axis of symmetry and centre of symmetry?
28. When do you say a molecule is chiral?
29. Whar is the number of isomers that C-7H-16 has?
30.What is a meso compound?
2. Name an isomer of diethyl ether?
3. Whatis the maximum number of isomers for an alkene C-4H-8?
4. What is dipole moment?
5. What is cis-trans isomerism?
6. What is the structural formula for 3,3-dimethyl-1-butene?
7. What is the structural formula for 3,3-dimethyl-1-butene?
8. If two compounds have same empirical formula, but different molecular formulae, what characteristics will be different?
9. What is the number of isomers c-6H-14 has?
10. What the Cl-C-Cl angle in tetrachloromethane?
11. What are the number of structural and configurational isomers of a bromo compound C-5H-9Br? How do you produce it?
12. what is keto-enol tautomerism?
13. give an example of keto-enol tautomerism.
14. What is the number of sigma and pi bonds in 1-butene-3-yne?
15. What is chirality?
16. What is a chiral carbon?
17. What is an asymmetric carbon?
18. What are conformers (conformation isomers)?
19. What is metamerism?
20. What tautomerism?
21. what are isomers?
22. What are stereo isomers?
23. what are enantiomers?
24. How can you separate two enantiomers?
25. Name some compounds that show optical activity.
26. what is the relationship between mesotartaric acid and d-tartaric acid in terms of isomerism?
27.What are axis of symmetry and centre of symmetry?
28. When do you say a molecule is chiral?
29. Whar is the number of isomers that C-7H-16 has?
30.What is a meso compound?
Sunday, September 2, 2007
Alkynes Simple Questions (S.Q.3)
Simple questions on reactions of Alkynes
1. When propyne is treated with acqeous H-2SO-4 in the presence of HgSO-4, which ketone is formed?
2. Which hydrocarbon contains acidic hydrogen?
3. Give bases stronger and weaker acetylene?
4. Give acids stronger than and weaker than acetylene?
5. To add water to a triple bond what other chemicals are required?
6. When R’MgBr reacts with RC- triple bond-CH, what alkane will result?
7. What are the products of ozonolysis of triple bond (alkyne)?
8. What is the output when ethyne is passed through hot iron tube at 400 degrees Celsius?
9. What is Lindlar’s catalyst?
10. Which alkene will emerge when alkyne is reduced with Lindlar’s catalyst?
11. Which alkene will emerge when alkyne is reduced with lithium metal in liquid ammonia solvent?
12. Among alkynes and alkenes, which are more reactive to halogens? Why?
13. What is the product obtained by adding water to 1-butyne in the presence of required catalysts? What are the catalysts?
14. What are tautomers?
15. What is final the output of polymerization of acetylene? What are intermediate outputs?
16. What are alkadienes?
17. What do you get by adding H-2 to 2-butyne? Give the two alternatives due to difference in reducing agents.
Please give your comments if any
1. When propyne is treated with acqeous H-2SO-4 in the presence of HgSO-4, which ketone is formed?
2. Which hydrocarbon contains acidic hydrogen?
3. Give bases stronger and weaker acetylene?
4. Give acids stronger than and weaker than acetylene?
5. To add water to a triple bond what other chemicals are required?
6. When R’MgBr reacts with RC- triple bond-CH, what alkane will result?
7. What are the products of ozonolysis of triple bond (alkyne)?
8. What is the output when ethyne is passed through hot iron tube at 400 degrees Celsius?
9. What is Lindlar’s catalyst?
10. Which alkene will emerge when alkyne is reduced with Lindlar’s catalyst?
11. Which alkene will emerge when alkyne is reduced with lithium metal in liquid ammonia solvent?
12. Among alkynes and alkenes, which are more reactive to halogens? Why?
13. What is the product obtained by adding water to 1-butyne in the presence of required catalysts? What are the catalysts?
14. What are tautomers?
15. What is final the output of polymerization of acetylene? What are intermediate outputs?
16. What are alkadienes?
17. What do you get by adding H-2 to 2-butyne? Give the two alternatives due to difference in reducing agents.
Please give your comments if any
Saturday, September 1, 2007
Alkynes Simple Questions (S.Q.2)
On methods of preparation
1. what is produced by hydrolysis of Calcium carbide?
2. What is produced by hydrolysis of magnesium carbide?
3. Name the potassium salt used to produce acetylene in Kolbe's electrolytic method.
4. what is the first stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
5. what is the second stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
6. what do you get in the first stage after reaction of 1,1 -dibromopentane with KOH(alc)?
7. How do you get ethyne from iodoform?
8. How do you get ethyne from chloroform?
9. what do you get by hydrolysis of Aluminium carbide?
10. which gaseous hydrocarbon is produced when calcium carbide reacts with water?
1. what is produced by hydrolysis of Calcium carbide?
2. What is produced by hydrolysis of magnesium carbide?
3. Name the potassium salt used to produce acetylene in Kolbe's electrolytic method.
4. what is the first stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
5. what is the second stage in dehydrohalenation of vicinal dihalides and what are the conditions required for the reaction?
6. what do you get in the first stage after reaction of 1,1 -dibromopentane with KOH(alc)?
7. How do you get ethyne from iodoform?
8. How do you get ethyne from chloroform?
9. what do you get by hydrolysis of Aluminium carbide?
10. which gaseous hydrocarbon is produced when calcium carbide reacts with water?
Sunday, August 19, 2007
Elimination reactions
Material relevant to main material blog
1. When heated with H-2SO-4, 2 degree alcohols undergo dehydration via an E1 mechanism.
The major product is the tri-substituted alkene, methylcyclohexene
2. When heated with strong bases such as NaOEt, alkyl bromides undergo E2 elimination.
The outcome of E2 reactions is dependent on the antiperiplanar arrangement of the C-H and C-LG bonds. For substituted cyclohexanes this requires that the LG be axial.
For the cis-isomer with the -Br axial, the more highly susbtituted alkene can be formed by removal of the H adjacent to the methyl group.
For the trans-isomer, when the -Br is axial the methyl group is also axial. Therefore the elimination must occur from the C3-H bond giving the anti-Zaitsev product.
The reactive conformation is an unfavourable diaxial conformer, therefore the reaction will be slower than that of the cis-isomer.
3. The lowest energy conformation of menthyl chloride has the chlorine atom in a equatorial postion.
In this position there is no antiperiplanar H , ring flip is difficult as it would require to formation of a triaxial conformer.
In contrast, in neomenthyl chloride, the lowest energy confromation has the chlorine atom axial with 2 H in the correct orientation to give the products. The major product is the more highly substituted alkene.
1. When heated with H-2SO-4, 2 degree alcohols undergo dehydration via an E1 mechanism.
The major product is the tri-substituted alkene, methylcyclohexene
2. When heated with strong bases such as NaOEt, alkyl bromides undergo E2 elimination.
The outcome of E2 reactions is dependent on the antiperiplanar arrangement of the C-H and C-LG bonds. For substituted cyclohexanes this requires that the LG be axial.
For the cis-isomer with the -Br axial, the more highly susbtituted alkene can be formed by removal of the H adjacent to the methyl group.
For the trans-isomer, when the -Br is axial the methyl group is also axial. Therefore the elimination must occur from the C3-H bond giving the anti-Zaitsev product.
The reactive conformation is an unfavourable diaxial conformer, therefore the reaction will be slower than that of the cis-isomer.
3. The lowest energy conformation of menthyl chloride has the chlorine atom in a equatorial postion.
In this position there is no antiperiplanar H , ring flip is difficult as it would require to formation of a triaxial conformer.
In contrast, in neomenthyl chloride, the lowest energy confromation has the chlorine atom axial with 2 H in the correct orientation to give the products. The major product is the more highly substituted alkene.
Thursday, August 16, 2007
Q.S. 2 Alkanes – Simple Questions (S.Q.S. 1)
1. What happens to boiling point of alkanes as molecular mass increases?
2. What happens to boiling point of branched isomers of alkanes?
3. Under what conditions does monochlorination of methane take place?
4. What is the `reaction in Kolbe Electrolytic method of preparing alkanes?
5. What are the reactants and products in hydrolysis of Grignard reagent?
6. In the case of halogenation of alkanes, what is order of reactivity among chlorine, fluorine, and bromine?
7. At ordinary temperatures, why is ultraviolet radiation required to initiate a reaction between halogens and alkanes?
8. What do you understand by 1 degree H, 2 degree H and 3 degree H?
9. What is the difference in reactions between an alkane and fluorine and an alkane and bromine?
10. What is the major product in reaction between bromine and n-butane?
11. What are the products of reaction between n-butane and chlorine at room temperature and sunlight?
12. How do you get iso-butane from n-butane?
13. When do you get aromatic compounds from alkanes?
14. What is the more common name of Methane?
15. What is % composition of Methane in coal gas?
16. How do you produce methane from aluminium chloride?
17. What are the reactants and products of Wurtz reaction?
Answer these questions. This will help you to answer other complex ways of asking questions like MCQs, multiple matching, passage based questions and fact & cause questions.
2. What happens to boiling point of branched isomers of alkanes?
3. Under what conditions does monochlorination of methane take place?
4. What is the `reaction in Kolbe Electrolytic method of preparing alkanes?
5. What are the reactants and products in hydrolysis of Grignard reagent?
6. In the case of halogenation of alkanes, what is order of reactivity among chlorine, fluorine, and bromine?
7. At ordinary temperatures, why is ultraviolet radiation required to initiate a reaction between halogens and alkanes?
8. What do you understand by 1 degree H, 2 degree H and 3 degree H?
9. What is the difference in reactions between an alkane and fluorine and an alkane and bromine?
10. What is the major product in reaction between bromine and n-butane?
11. What are the products of reaction between n-butane and chlorine at room temperature and sunlight?
12. How do you get iso-butane from n-butane?
13. When do you get aromatic compounds from alkanes?
14. What is the more common name of Methane?
15. What is % composition of Methane in coal gas?
16. How do you produce methane from aluminium chloride?
17. What are the reactants and products of Wurtz reaction?
Answer these questions. This will help you to answer other complex ways of asking questions like MCQs, multiple matching, passage based questions and fact & cause questions.
Sunday, June 24, 2007
IIT JEE Chemistry Level I Practice Set I Ores and Minerals Inor. Chemistry
Match the metal and mineral
Metal -----Mineral
Aluminium----Limonite
Aluminium----Tin stone
Copper ----Azurite
gold ----Cerussite
Iron ----Carnallite
Lead ----Cryolite
Magnesium ----Calamine
silver---- Proustite
Tin ---- Corundum
Zinc ----- Calaverite
For answers see http://iit-jee-chemistry-aps.blogspot.com/
Metal -----Mineral
Aluminium----Limonite
Aluminium----Tin stone
Copper ----Azurite
gold ----Cerussite
Iron ----Carnallite
Lead ----Cryolite
Magnesium ----Calamine
silver---- Proustite
Tin ---- Corundum
Zinc ----- Calaverite
For answers see http://iit-jee-chemistry-aps.blogspot.com/
Saturday, June 23, 2007
Ganeshaya Namah
I seek the blessings of Lord Ganesha, the lord who makes things proceed without obstacles.
I seek the blessings of Goddess Saraswati, the deity of education. Her blessings on the mankind will make more people highly educated and make the earth and universe more comfortable and happy places to live in.
I seek the blessings of Goddess Saraswati, the deity of education. Her blessings on the mankind will make more people highly educated and make the earth and universe more comfortable and happy places to live in.
Subscribe to:
Posts (Atom)
